Inselberg, Rettenegg, Weiz District, Styria, Austriai
| Regional Level Types | |
|---|---|
| Inselberg | - not defined - |
| Rettenegg | Municipality |
| Weiz District | District |
| Styria | State |
| Austria | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
47° 31' 39'' North , 15° 50' 13'' East
Latitude & Longitude (decimal):
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Feistritzwald | 109 (2018) | 1.4km |
| Rettenegg | 575 (2018) | 4.2km |
| Kaltenegg | 111 (2018) | 6.1km |
| Arzberg | 422 (2018) | 7.4km |
| Kirchenviertel | 554 (2018) | 7.5km |
Name(s) in local language(s):
Inselberg, Rettenegg, Fischbacher Alpen, Steiermark, Österreich
Forest road cut, outcrops and boulders of lower Triassic Semmering quartzite with lazulite-bearing quartz veinlets. Located ca. 300 m SSE of Inselberg Mt. at an elevation of ca. 1260 m asl.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Churchite-(Y) Formula: Y(PO4) · 2H2O Description: Pale orange to pale rose balls up to 0.5 mm large, consisting of radiating needles. |
| ⓘ Gorceixite Formula: BaAl3(PO4)(PO3OH)(OH)6 Description: Colorless, glassy aggregates with lazulite inclusions, accompanying churchite-(Y). |
| ⓘ Hematite Formula: Fe2O3 References: C.Auer (2025)Identified by Christian Auer: SEM-EDS |
| ⓘ Lazulite Formula: MgAl2(PO4)2(OH)2 Colour: blue Description: Up to cm-sized blue masses in quartz veinlets and also finely disseminated in quartzite. References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Description: rock-forming mineral References: C.Auer (2025)Identified by Christian Auer: SEM-EDS |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 References: C.Auer (2025)Identified by Christian Auer: SEM-EDS |
| ⓘ Pyrite Formula: FeS2 References: C.Auer (2025)Identified by Christian Auer: SEM-EDS |
| ⓘ Quartz Formula: SiO2 Habit: massive vein quartz Colour: white References: |
| ⓘ Rutile Formula: TiO2 Description: Accessory, rock-forming mineral References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: C.Auer (2025)Identified by Christian Auer: SEM-EDS |
| ⓘ Svanbergite Formula: SrAl3(PO4)(SO4)(OH)6 Description: Colorless, glassy aggregates with lazulite inclusions, accompanying churchite-(Y). |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Lazulite | 8.BB.40 | MgAl2(PO4)2(OH)2 |
| ⓘ | Svanbergite | 8.BL.05 | SrAl3(PO4)(SO4)(OH)6 |
| ⓘ | Gorceixite | 8.BL.10 | BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Churchite-(Y) | 8.CJ.50 | Y(PO4) · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Si | Silicon | |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| P | Phosphorus | |
| P | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| P | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| P | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| K | Potassium | |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Cr | Chromium | |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Sr | Strontium | |
| Sr | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Y | Yttrium | |
| Y | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| Ba | Barium | |
| Ba | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
Other Regions, Features and Areas containing this locality
Austria
- Styria
- Fischbach AlpsMountain Range
Eurasian PlateTectonic Plate
- Panonian BasinWide Rift
EuropeContinent
- The AlpsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.







Inselberg, Rettenegg, Weiz District, Styria, Austria