Kő hill quarry, Kópháza, Győr-Moson-Sopron County, Hungaryi
| Regional Level Types | |
|---|---|
| Kő hill quarry | Quarry |
| Kópháza | Village |
| Győr-Moson-Sopron County | County |
| Hungary | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
47° 39' 17'' North , 16° 37' 57'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Sopron | 57,210 (2015) | 4.6km |
| Deutschkreutz | 2,791 (2018) | 6.1km |
| Girm | 297 (2018) | 6.4km |
| Fertőrákos | 2,179 (2011) | 7.4km |
| Nagycenk | 1,856 (2012) | 7.4km |
Other Languages:
Hungarian:
Kő hegy, Kópháza, Győr-Moson-Sopron megye, Magyarország
Gneiss quarry on Kő hill near Kópháza.
Kő-hegy ("Stone Hill") quarry.
Actually located within the boundaries of Sopron.
HP-LT blueschist-facies, garnet-bearing orthogneisses in the Grobgneiss series of the Eastern Alps.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Anglesite Formula: PbSO4 References: |
| ⓘ Annite Formula: KFe2+3(AlSi3O10)(OH)2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Chalcopyrite Formula: CuFeS2 References: |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ 'Feldspar Group' |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ Galena Formula: PbS References: |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O References: |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ 'K Feldspar' |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O References: |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Phengite Formula: KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 Description: Si-rich phengite, polytype 3T. |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Sphalerite Formula: ZnS References: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | Iron | |
| Fe | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Galena | PbS |
| U | Uranium | |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.




Kő hill quarry, Kópháza, Győr-Moson-Sopron County, Hungary