Root Mine, Goodsprings Mining District, Spring Mountains, Clark County, Nevada, USAi
| Regional Level Types | |
|---|---|
| Root Mine | Mine |
| Goodsprings Mining District | Mining District |
| Spring Mountains | Mountain Range |
| Clark County | County |
| Nevada | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
35° 46' 41'' North , 115° 32' 41'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Sandy Valley | 2,051 (2011) | 9.0km |
| Goodsprings | 229 (2011) | 11.7km |
| Blue Diamond | 290 (2011) | 32.4km |
| Enterprise | 108,481 (2011) | 38.7km |
| Summerlin South | 24,085 (2012) | 42.3km |
Other/historical names associated with this locality:
Bonanza Hill Mine
Sec 13 T25S R57E. Pb, Zn, Ag, Cu, Au.
Structure: SE limb of anticline trending NE; numerous joints and shear zones, fault with 100 - 200 ft (ca. 61 m) of displacement.
Deposit type: Polymetallic replacement.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
19 valid minerals.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) References: |
| ⓘ Fornacite Formula: Pb2Cu(CrO4)(AsO4)(OH) References: |
| ⓘ Galena Formula: PbS |
| ⓘ Hemihedrite Formula: Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Perroudite Formula: Hg5Ag4S5(I,Br)2Cl2 |
| ⓘ Phosphohedyphane Formula: Ca2Pb3(PO4)3Cl Colour: colorless, gray green, yellow |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl References: Thorne, Brent (n.d.) Personal communcation.In the collection of Brent Thorne. SEM-EDS analyzed. |
| ⓘ Wulfenite Formula: Pb(MoO4) References: Thorne, Brent (n.d.) Personal communcation.In the collection of Brent Thorne. SEM-EDS analyzed. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Perroudite | 2.FC.20c | Hg5Ag4S5(I,Br)2Cl2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Fornacite | 7.FC.10 | Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ | Hemihedrite | 7.FC.15 | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| H | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| C | Carbon | |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| O | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Al | Aluminium | |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | Silicon | |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Galena | PbS |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Ca | Calcium | |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| V | Vanadium | |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cr | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | Copper | |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Br | Bromine | |
| Br | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| I | Iodine | |
| I | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| Hg | Mercury | |
| Hg | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
Other Databases
| Link to USGS MRDS: | 10037233 |
|---|
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- Basin and Range BasinsBasin
- Bird Spring BasinBasin
- Mojave DomainDomain
- Southern Basin and RangeWide Rift
USA
- Mojave DesertDesert
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Root Mine, Goodsprings Mining District, Spring Mountains, Clark County, Nevada, USA