Bedovina mine, Predazzo, Trento Province, Trentino-Alto Adige/Südtirol, Italyi
| Regional Level Types | |
|---|---|
| Bedovina mine | Mine (Abandoned) |
| Predazzo | Commune |
| Trento Province | Autonomous Province |
| Trentino-Alto Adige/Südtirol | Autonomous Region |
| Italy | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
46° 19' 45'' North , 11° 37' 2'' East
Latitude & Longitude (decimal):
Type:
Mine (Abandoned) - last checked 2025
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Predazzo | 4,254 (2014) | 2.4km |
| Forno | 131 (2014) | 2.5km |
| Bellamonte | 137 (2018) | 3.9km |
| Sorte | 128 (2014) | 5.5km |
| Moena | 2,300 (2014) | 6.2km |
Other Languages:
Italian:
Mina Bedovina, Predazzo, Provincia Autonoma di Trento (Trentino), Trentino-Alto Adige, Italia
Old Cu-W mine.
The mineralization is hosted in a stockwork of veins which intersects the volcanics and, occasionally, granitoid masses, and rarely acidic and mafic veins. Two different metalliferous phases can be recognized, the first mainly wolfram-bearing, the second copper-polymetallic (Frizzo et al., 2010).
The mineralisation is related to hydrothermal metal fluids derived from the crystallisation of two distinct granitoid magmas.
Known for nice scheelite crystals.
The mineralization is hosted in a stockwork of veins which intersects the volcanics and, occasionally, granitoid masses, and rarely acidic and mafic veins. Two different metalliferous phases can be recognized, the first mainly wolfram-bearing, the second copper-polymetallic (Frizzo et al., 2010).
The mineralisation is related to hydrothermal metal fluids derived from the crystallisation of two distinct granitoid magmas.
Known for nice scheelite crystals.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
28 valid minerals.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A References: |
| ⓘ Arcubisite Formula: Ag6CuBiS4 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Chalcopyrite Formula: CuFeS2 References: |
| ⓘ 'Chlorite Group' |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Galena Formula: PbS References: |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ 'Limonite' |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pilsenite Formula: Bi4Te3 |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Sarcolite Formula: Na4Ca12Al8Si12O46(SiO4,PO4)(OH,H2O)4(CO3,Cl) |
| ⓘ Scheelite Formula: Ca(WO4) References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Sphalerite Formula: ZnS References: |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F |
| ⓘ 'Tetrahedrite Group' Formula: M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Zircon Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pilsenite | 2.DC.05 | Bi4Te3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Arcubisite | 2.LA.40 | Ag6CuBiS4 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Sarcolite | 9.EH.15 | Na4Ca12Al8Si12O46(SiO4,PO4)(OH,H2O)4(CO3,Cl) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Tetrahedrite Group' | - | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Sarcolite | Na4Ca12Al8Si12O46(SiO4,PO4)(OH,H2O)4(CO3,Cl) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Sarcolite | Na4Ca12Al8Si12O46(SiO4,PO4)(OH,H2O)4(CO3,Cl) |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sarcolite | Na4Ca12Al8Si12O46(SiO4,PO4)(OH,H2O)4(CO3,Cl) |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Na | Sodium | |
| Na | ⓘ Sarcolite | Na4Ca12Al8Si12O46(SiO4,PO4)(OH,H2O)4(CO3,Cl) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Sarcolite | Na4Ca12Al8Si12O46(SiO4,PO4)(OH,H2O)4(CO3,Cl) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Sarcolite | Na4Ca12Al8Si12O46(SiO4,PO4)(OH,H2O)4(CO3,Cl) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Zircon | Zr(SiO4) |
| P | Phosphorus | |
| P | ⓘ Sarcolite | Na4Ca12Al8Si12O46(SiO4,PO4)(OH,H2O)4(CO3,Cl) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Arcubisite | Ag6CuBiS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Galena | PbS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tetrahedrite Group | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| Cl | Chlorine | |
| Cl | ⓘ Sarcolite | Na4Ca12Al8Si12O46(SiO4,PO4)(OH,H2O)4(CO3,Cl) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Sarcolite | Na4Ca12Al8Si12O46(SiO4,PO4)(OH,H2O)4(CO3,Cl) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Fe | Iron | |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Cu | Copper | |
| Cu | ⓘ Arcubisite | Ag6CuBiS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Arcubisite | Ag6CuBiS4 |
| Ag | ⓘ Hessite | Ag2Te |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Stibnite | Sb2S3 |
| Te | Tellurium | |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Pilsenite | Bi4Te3 |
| Ce | Cerium | |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Arcubisite | Ag6CuBiS4 |
| Bi | ⓘ Pilsenite | Bi4Te3 |
Geochronology
Mineralization age: Middle Triassic : 237,3 ± 1 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||
| Mesozoic | |||||||
| Triassic | |||||||
| Late/Upper Triassic |
| ||||||
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- DinaridesAccretionary Complex
EuropeContinent
- The AlpsMountain Range
Italy
- DolomitesMountain Range
- Trentino-Alto Adige/Südtirol
- Trento Province
- Fiemme ValleyValley
- Trento Province
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Folie, K. (1984) Die Mineralien Südtirols und des Trentino. Verlag Tappeiner, Lana b. Meran, 200 pp.
Filipponi, Alessandro (2018) Modellizzazione petrogenetica dell'origine e dell'evoluzione dei complessi intrusivi di Predazzo e dei Monti Monzoni [Petrogenetic modeling of the origin and evolution of the Predazzo and Monti Monzoni intrusive complexes]. Laurea Magistrale [Master's Degree], Università di Bologna, Corso di Studio in Geologia e Territorio. p.15 - Complesso Intrusivo di Predazzo
(2025) Minerali e rocce del Monte Mulat [Minerals and rocks of Mount Mulat], Museo delle Scienze di Trento (MUSE) - Museo Geologico delle Dolomiti in Predazzo.Showcase with historic specimens from the Bedovina mine (vetrina con esemplari storici dalla miniera della Bedovina).
Bedovina mine, Predazzo, Trento Province, Trentino-Alto Adige/Südtirol, Italy