Tin Queen Mine (White Blowout Mine), Hill City Mining District, Pennington County, South Dakota, USAi
| Regional Level Types | |
|---|---|
| Tin Queen Mine (White Blowout Mine) | Mine |
| Hill City Mining District | Mining District |
| Pennington County | County |
| South Dakota | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
43° 52' 1'' North , 103° 35' 46'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Hill City | 995 (2017) | 7.4km |
| Custer | 1,952 (2017) | 11.2km |
| Keystone | 343 (2017) | 14.6km |
| Johnson Siding | 659 (2017) | 27.3km |
| Colonial Pine Hills | 2,493 (2017) | 27.4km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Western Dakota Gem & Mineral Society | Rapid City, South Dakota | 38km |
5 miles SE of town.
REF:Deposit:: PAGE LINCOLN R ET AL PEGMATITE INVESTIGATIONS 1942-43 BLACK
Deposit:: DAKOTA U S GEO SURV PROF PAR 2471953 PP58 201-203 P139.
Deposit:: U S BUMINES STAFF REGION V BLACK HILLS MINERAL ATLAS S DAKOT
Deposit:: 2 I C 7707 1955 P60
Commodities (Trace) - Tantalum, Niobium (Columbium)
Development Status: Past Producer
REF:Deposit:: PAGE LINCOLN R ET AL PEGMATITE INVESTIGATIONS 1942-43 BLACK
Deposit:: DAKOTA U S GEO SURV PROF PAR 2471953 PP58 201-203 P139.
Deposit:: U S BUMINES STAFF REGION V BLACK HILLS MINERAL ATLAS S DAKOT
Deposit:: 2 I C 7707 1955 P60
Commodities (Trace) - Tantalum, Niobium (Columbium)
Development Status: Past Producer
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Amblygonite Formula: LiAl(PO4)F |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Diopside ? Formula: CaMgSi2O6 |
| ⓘ Dufrénite ? Formula: Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O References: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Frondelite Formula: (Mn2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 References: |
| ⓘ Heterosite Formula: Fe3+(PO4) |
| ⓘ Hureaulite Formula: Mn2+5(PO3OH)2(PO4)2 · 4H2O |
| ⓘ Ilmenite Formula: Fe2+TiO3 References: |
| ⓘ Kyanite ? Formula: Al2(SiO4)O |
| ⓘ Lithiophilite Formula: LiMn2+PO4 References: |
| ⓘ Lithiophilite var. Sicklerite Formula: Li1-x(Mn3+xMn2+1-x)PO4 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Mitridatite Formula: Ca2Fe3+3(PO4)3O2 · 3H2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Pollucite ? Formula: (Cs,Na)2(Al2Si4O12) · 2H2O Description: Error in reporting - should be Tin Mountain Mine, Custer county. |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rockbridgeite Formula: (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ Triphylite Formula: LiFe2+PO4 |
| ⓘ Triplite ? Formula: Mn2+2(PO4)F |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Heterosite | 8.AB.10 | Fe3+(PO4) |
| ⓘ | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
| ⓘ | var. Sicklerite | 8.AB.10 | Li1-x(Mn3+xMn2+1-x)PO4 |
| ⓘ | Triphylite | 8.AB.10 | LiFe2+PO4 |
| ⓘ | Amblygonite | 8.BB.05 | LiAl(PO4)F |
| ⓘ | Triplite ? | 8.BB.10 | Mn2+2(PO4)F |
| ⓘ | Frondelite | 8.BC.10 | (Mn2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ | Rockbridgeite | 8.BC.10 | (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hureaulite | 8.CB.10 | Mn2+5(PO3OH)2(PO4)2 · 4H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Mitridatite | 8.DH.30 | Ca2Fe3+3(PO4)3O2 · 3H2O |
| ⓘ | Dufrénite ? | 8.DK.15 | Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Kyanite ? | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside ? | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Pollucite ? | 9.GB.05 | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| H | ⓘ Frondelite | (Mn2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| H | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| H | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| H | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Li | Lithium | |
| Li | ⓘ Amblygonite | LiAl(PO4)F |
| Li | ⓘ Lithiophilite | LiMn2+PO4 |
| Li | ⓘ Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| Li | ⓘ Triphylite | LiFe2+PO4 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amblygonite | LiAl(PO4)F |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Frondelite | (Mn2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| O | ⓘ Heterosite | Fe3+(PO4) |
| O | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Lithiophilite | LiMn2+PO4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Triphylite | LiFe2+PO4 |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| F | Fluorine | |
| F | ⓘ Amblygonite | LiAl(PO4)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Triplite | Mn22+(PO4)F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amblygonite | LiAl(PO4)F |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Amblygonite | LiAl(PO4)F |
| P | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Frondelite | (Mn2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| P | ⓘ Heterosite | Fe3+(PO4) |
| P | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| P | ⓘ Lithiophilite | LiMn2+PO4 |
| P | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| P | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| P | ⓘ Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| P | ⓘ Triphylite | LiFe2+PO4 |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | Calcium | |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Mn | Manganese | |
| Mn | ⓘ Frondelite | (Mn2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| Mn | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| Mn | ⓘ Lithiophilite | LiMn2+PO4 |
| Mn | ⓘ Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Frondelite | (Mn2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| Fe | ⓘ Heterosite | Fe3+(PO4) |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| Fe | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Triphylite | LiFe2+PO4 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Sr | Strontium | |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Cs | Caesium | |
| Cs | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Ba | Barium | |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- Wyoming CratonCraton
- Wyoming DomainDomain
USA
- Black HillsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.

Tin Queen Mine, Hill City Mining District, Pennington County, South Dakota, USA