Emakhazeni Local Municipality, Nkangala District Municipality, Mpumalanga, South Africai
| Regional Level Types | |
|---|---|
| Emakhazeni Local Municipality | Municipality |
| Nkangala District Municipality | District |
| Mpumalanga | Province |
| South Africa | Country |
This page is currently not sponsored. Click here to sponsor this page.
Area:
4,736 km2
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Belfast | 11,916 (2012) |
Other Languages:
French:
Emakhazeni, Mpumalanga, Afrique du Sud
German:
Emakhazeni, Mpumalanga, Südafrika
Italian:
Municipalità locale di Emakhazeni, Mpumalanga, Sudafrica
Russian:
Эмакхазени, Мпумаланга, ЮАР
Simplified Chinese:
埃馬克哈澤尼地方自治市, 普馬蘭加省, 南非
Afrikaans:
Emakhazeni Plaaslike Munisipaliteit, Mpumalanga, Suid-Afrika
Bulgarian:
Емакхазени, Мпумаланга, Република Южна Африка
Cebuano:
Emakhazeni, Mpumalanga, Habagatang Aprika
Dutch:
Emakhazeni, Mpumalanga, Zuid-Afrika
Northern Sotho:
Emakhazeni Mmusogae, Mpumalanga, Afrika Borwa
Novial:
Highlands Komunie, Mpumalanga, Sud Afrika
Polish:
Emakhazeni, Mpumalanga, Republika Południowej Afryki
Welsh:
Bwrdeistref Lleol Emakhazeni, De Affrica
Zulu:
Emakhazeni Local Municipality, Mpumalanga, iNingizimu Afrika
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities25 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Diamond Formula: C |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Marlin Norite Quarry, Belfast, Emakhazeni Local Municipality, Nkangala District Municipality, Mpumalanga, South Africa Rietvlei Farm, Belfast, Emakhazeni Local Municipality, Nkangala District Municipality, Mpumalanga, South Africa Vlakplaats Farm, Belfast, Emakhazeni Local Municipality, Nkangala District Municipality, Mpumalanga, South Africa |
| ⓘ Galena Formula: PbS |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hydroxyapophyllite-(K) Formula: KCa4(Si8O20)(OH,F) · 8H2O |
| ⓘ Julgoldite-(Fe3+) Formula: Ca2Fe3+Fe3+2[Si2O6OH][SiO4](OH)2O Habit: acicular Colour: dark-green Description: First reported find of this mineral in South Africa |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Gold Formula: Au |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Siderite var. Sideroplesite Formula: (Fe,Mg)CO3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Diamond | 1.CB.10a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | var. Sideroplesite | 5.AB.05 | (Fe,Mg)CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Julgoldite-(Fe3+) | 9.BG.20 | Ca2Fe3+Fe3+2[Si2O6OH][SiO4](OH)2O |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Hydroxyapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(OH,F) · 8H2O |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Julgoldite-(Fe3+) | Ca2Fe3+Fe23+[Si2O6OH][SiO4](OH)2O |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Diamond | C |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Siderite var. Sideroplesite | (Fe,Mg)CO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Siderite var. Sideroplesite | (Fe,Mg)CO3 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Julgoldite-(Fe3+) | Ca2Fe3+Fe23+[Si2O6OH][SiO4](OH)2O |
| F | Fluorine | |
| F | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Siderite var. Sideroplesite | (Fe,Mg)CO3 |
| Al | Aluminium | |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Julgoldite-(Fe3+) | Ca2Fe3+Fe23+[Si2O6OH][SiO4](OH)2O |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Julgoldite-(Fe3+) | Ca2Fe3+Fe23+[Si2O6OH][SiO4](OH)2O |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Siderite var. Sideroplesite | (Fe,Mg)CO3 |
| Fe | ⓘ Julgoldite-(Fe3+) | Ca2Fe3+Fe23+[Si2O6OH][SiO4](OH)2O |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Emakhazeni_Local_Municipality |
|---|---|
| Wikidata ID: | Q2317194 |
| GeoNames ID: | 8347506 |
Localities in this Region
- Mpumalanga
- Nkangala District Municipality
- Emakhazeni Local Municipality
- Nkangala District Municipality
- Mpumalanga
- Nkangala District Municipality
- Emakhazeni Local Municipality
- Nkangala District Municipality
Other Regions, Features and Areas that Intersect
AfricaContinent
African Plate
- Kalahari Craton
- Kaapvaal CratonCraton
- Karoo basinBasin
Somali PlateTectonic Plate
South Africa
- Bushveld ComplexComplex
- Mpumalanga
- Ehlanzeni District Municipality
- Thaba Chweu Local Municipality
- Pilgrim's Rest - Sabie ore fieldMining Field
- Thaba Chweu Local Municipality
- Ehlanzeni District Municipality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions





Belfast Collieries, Belfast, Emakhazeni Local Municipality, Nkangala District Municipality, Mpumalanga, South Africa