Rat Tail claim (Pack Rat claim), Belmont Mountains, Maricopa County, Arizona, USAi
| Regional Level Types | |
|---|---|
| Rat Tail claim (Pack Rat claim) | Claim |
| Belmont Mountains | Mountain Range |
| Maricopa County | County |
| Arizona | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
34° 1' 51'' North , 112° 48' 22'' West
Latitude & Longitude (decimal):
Type:
Deposit first discovered:
1967
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Wickenburg | 6,806 (2017) | 9.9km |
| Congress | 1,975 (2014) | 15.2km |
| Yarnell | 649 (2011) | 21.9km |
| Morristown | 227 (2017) | 25.7km |
| Peeples Valley | 428 (2011) | 27.4km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Wickenburg Gem and Mineral Society | Wickenburg, Arizona | 10km |
Other/historical names associated with this locality:
Osborne Mining District
This prospect is located in the SW/4,SW/4, T4N,R7W, on the northeast side of a range of hills oriented northwest-southeast. Access is by dirt road that follows Coyote Creek to the Scott Mine, in this vicinity there is a fork to the northwest. Park where this road crosses the section 15-17 line, there is an arroyo on the northeast side of the road. Hike approximately 1 km to the northeast (through a low pass in the hills then turn northwest, the prospect pit is hard to find in the desert scrub, it is lower than where the hill gets very steep. Pit and dump cover an area about 10 x 8 meters.
Prospect was discovered in 1967 by exploration geologists mapping in the area.
Location is +/- 200 meters.
Prospect was discovered in 1967 by exploration geologists mapping in the area.
Location is +/- 200 meters.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Anglesite Formula: PbSO4 References: |
| ⓘ Boleite Formula: KPb26Ag9Cu24(OH)48Cl62 References: |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) References: |
| ⓘ Fluorite Formula: CaF2 Description: (blue, with wickenburgite) References: |
| ⓘ Galena Formula: PbS |
| ⓘ Hematite Formula: Fe2O3 References: |
| ⓘ Hemihedrite Formula: Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Phoenicochroite Formula: Pb2(CrO4)O References: |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Vauquelinite Formula: Pb2Cu(CrO4)(PO4)(OH) |
| ⓘ Wickenburgite Formula: CaPb3Al2Si10O24(OH)6 |
| ⓘ Willemite Formula: Zn2SiO4 References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Boleite | 3.DB.15 | KPb26Ag9Cu24(OH)48Cl62 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Phoenicochroite | 7.FB.05 | Pb2(CrO4)O |
| ⓘ | Vauquelinite | 7.FC.05 | Pb2Cu(CrO4)(PO4)(OH) |
| ⓘ | Hemihedrite | 7.FC.15 | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Wickenburgite | 9.EG.55 | CaPb3Al2Si10O24(OH)6 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| H | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| H | ⓘ Wickenburgite | CaPb3Al2Si10O24(OH)6 |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Phoenicochroite | Pb2(CrO4)O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| O | ⓘ Wickenburgite | CaPb3Al2Si10O24(OH)6 |
| O | ⓘ Willemite | Zn2SiO4 |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Al | Aluminium | |
| Al | ⓘ Wickenburgite | CaPb3Al2Si10O24(OH)6 |
| Si | Silicon | |
| Si | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Wickenburgite | CaPb3Al2Si10O24(OH)6 |
| Si | ⓘ Willemite | Zn2SiO4 |
| P | Phosphorus | |
| P | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| K | Potassium | |
| K | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Wickenburgite | CaPb3Al2Si10O24(OH)6 |
| V | Vanadium | |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| Cr | Chromium | |
| Cr | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Cr | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Cr | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Fe | Iron | |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Cu | Copper | |
| Cu | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cu | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Zn | Zinc | |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Willemite | Zn2SiO4 |
| As | Arsenic | |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Ag | Silver | |
| Ag | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Pb | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Pb | ⓘ Wickenburgite | CaPb3Al2Si10O24(OH)6 |
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- Basin and Range BasinsBasin
- Mojave DomainDomain
- Southern Basin and RangeWide Rift
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Williams, Sidney A. (1968) Wickenburgite, a new mineral from Arizona. American Mineralogist, 53 (9-10) 1433-1438
Williams, Sidney A., McLean, W. John, Anthony, John W. (1970) A study of phoenicochroite - its structure and properties. American Mineralogist, 55 (5-6) 784-792
Rat Tail claim, Belmont Mountains, Maricopa County, Arizona, USA