Am Gleichen quarry, Lütschenbach quarries, Lütschenbach, Malsburg, Malsburg-Marzell, Lörrach, Freiburg Region, Baden-Württemberg, Germanyi
| Regional Level Types | |
|---|---|
| Am Gleichen quarry | Quarry |
| Lütschenbach quarries | Group of Quarries (Active) |
| Lütschenbach | Hamlet |
| Malsburg | Municipality (Former) |
| Malsburg-Marzell | Municipality |
| Lörrach | District |
| Freiburg Region | Region |
| Baden-Württemberg | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
47° 44' 44'' North , 7° 43' 42'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Name(s) in local language(s):
Steinbruch am Gleichen, Lütschenbacher Steinbrüche, Lütschenbach, Malsburg, Kandern, Schwarzwald, Baden-Württemberg, Deutschland
Abandoned overgrown and partly built-over small quarry W of Am Gleichen.
Granite with miarolitic cavities, pegmatite inclusions and aplite veins.
Note: Coordinates to be confirmed. There is another small overgrown quarrry ("Steinbruch Malsburg-Marzell" according to OpenStreetMap) at 47.7472, 7.7281.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O22]X · 8H2O References: |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcopyrite Formula: CuFeS2 References: |
| ⓘ 'Chlorite Group' References: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) References: |
| ⓘ Fluorite Formula: CaF2 References: |
| ⓘ Hematite Formula: Fe2O3 References: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 References: |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Orthoclase Formula: K(AlSi3O8) References: |
| ⓘ Powellite Formula: Ca(MoO4) References: |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 References: |
| ⓘ Pumpellyite-(Mg) Formula: Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ Pumpellyite-(Mn2+) Formula: Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Pyrrhotite Formula: Fe1-xS References: |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z References: |
| ⓘ 'Zinnwaldite' |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| Group 9 - Silicates | |||
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Pumpellyite-(Mg) | 9.BG.20 | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ | Pumpellyite-(Mn2+) | 9.BG.20 | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O22]X · 8H2O |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Zinnwaldite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| H | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| B | Boron | |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| O | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| Al | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| Si | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| S | Sulfur | |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| K | Potassium | |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| Ca | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Mn | Manganese | |
| Mn | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Fe | Iron | |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Moldanubian BeltOrogenic Belt
EuropeContinent
Germany
- Baden-Württemberg
- Black ForestMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.