Kohsai, Minami-Alps City, Yamanashi Prefecture, Japani
| Regional Level Types | |
|---|---|
| Kohsai | - not defined - |
| Minami-Alps City | City |
| Yamanashi Prefecture | Prefecture |
| Japan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
35° North , 138° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~18km
Köppen climate type:
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities12 valid minerals. 1 (TL) - type locality of valid minerals.
Detailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Caryopilite Formula: Mn2+3Si2O5(OH)4 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Johannsenite Formula: CaMn2+Si2O6 |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ Pumpellyite-(Mn2+) (TL) Formula: Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) Type Locality: |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rhodochrosite Formula: MnCO3 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| Group 9 - Silicates | |||
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Pumpellyite-(Mn2+) (TL) | 9.BG.20 | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ | Johannsenite | 9.DA.15 | CaMn2+Si2O6 |
| ⓘ | Caryopilite | 9.ED.15 | Mn2+3Si2O5(OH)4 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Rhodochrosite | MnCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Johannsenite | CaMn2+Si2O6 |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Johannsenite | CaMn2+Si2O6 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Si | ⓘ Quartz | SiO2 |
| K | Potassium | |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Johannsenite | CaMn2+Si2O6 |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Mn | Manganese | |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Johannsenite | CaMn2+Si2O6 |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
Localities in this Region
- Yamanashi Prefecture
- Minami-Alps City
- Kohsai
- Minami-Alps City
Other Regions, Features and Areas containing this locality
AsiaContinent
Eurasian Plate
- Southern Japan ForearcAccretionary Complex
Japan
- Honshu IslandIsland
- Japanese Alps
Okhotsk PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.



Ochiai mine, Kohsai, Minami-Alps City, Yamanashi Prefecture, Japan