Sedimentary Holdings alluvial gold operations, Amphitheatre, Pyrenees Shire, Victoria, Australiai
| Regional Level Types | |
|---|---|
| Sedimentary Holdings alluvial gold operations | - not defined - |
| Amphitheatre | - not defined - |
| Pyrenees Shire | Shire |
| Victoria | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
37° 10' 59'' South , 143° 24' 0'' East
Latitude & Longitude (decimal):
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Maryborough | 7,046 (2013) | 33.7km |
| Ararat | 8,076 (2015) | 43.3km |
| Cardigan | 647 (2015) | 49.7km |
| Newington | 1,888 (2015) | 56.1km |
| Lake Wendouree | 1,471 (2015) | 56.8km |
At Amphitheatre in the 1990s some alluvial gold was produced by mining a paleoplacer in the White Hills Gravel.
Located 11 km SW of Avoca.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Corundum var. Ruby Formula: Al2O3 |
| ⓘ Corundum var. Sapphire Formula: Al2O3 |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Maghemite Formula: (Fe3+0.67◻0.33)Fe3+2O4 References: Steve Sorrell CollectionIdentification: Visual Identification |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Native Gold Formula: Au |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Zircon Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Maghemite | 4.BB.15 | (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Zircon | Zr(SiO4) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Zircon | Zr(SiO4) |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
Other Regions, Features and Areas containing this locality
Australia
- Lachlan OrogenOrogen
Australian PlateTectonic Plate
- Lachlan Fold Belt
- Stalwell ZoneOrogenic Belt
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Sedimentary Holdings alluvial gold operations, Amphitheatre, Pyrenees Shire, Victoria, Australia