Kilchoan, Ardnamurchan, Fort William and Ardnamurchan, Highland, Scotland, UKi
| Regional Level Types | |
|---|---|
| Kilchoan | Hamlet |
| Ardnamurchan | - not defined - |
| Fort William and Ardnamurchan | Ward |
| Highland | Council Area |
| Scotland | Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
56° 41' 53'' North , 6° 6' 15'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Tobermory | 1,010 (2017) | 8.7km |
| Isle of Coll | 164 (2012) | 29.2km |
| Isle Of Mull | 2,667 (2014) | 34.5km |
| Mallaig | 780 (2017) | 37.7km |
| Isle of Iona | 125 (2015) | 45.0km |
Other/historical names associated with this locality:
Argyllshire
The coordinates mark the town church.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities20 valid minerals. 3 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | var. Sapphire | 4.CB.05 | Al2O3 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Ettringite | 7.DG.15 | Ca6Al2(SO4)3(OH)12 · 26H2O |
| Group 9 - Silicates | |||
| ⓘ | Monticellite | 9.AC.10 | CaMg(SiO4) |
| ⓘ | Larnite | 9.AD.05 | Ca2SiO4 |
| ⓘ | Merwinite | 9.AD.15 | Ca3Mg(SiO4)2 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spurrite | 9.AH.15 | Ca5(SiO4)2(CO3) |
| ⓘ | Åkermanite | 9.BB.10 | Ca2Mg[Si2O7] |
| ⓘ | Rankinite | 9.BC.15 | Ca3Si2O7 |
| ⓘ | Cuspidine | 9.BE.17 | Ca8(Si2O7)2F4 |
| ⓘ | Tilleyite | 9.BE.82 | Ca5(Si2O7)(CO3)2 |
| ⓘ | Rustumite (TL) | 9.BG.30 | Ca10(Si2O7)2(SiO4)(OH)2Cl2 |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Dellaite (TL) | 9.BG.45 | Ca6Si3O11(OH)2 |
| ⓘ | Kilchoanite (TL) | 9.BJ.45 | Ca6(SiO4)(Si3O10) |
| ⓘ | Scawtite | 9.CK.15 | Ca7(Si3O9)2CO3 · 2H2O |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Plombièrite | 9.DG.08 | Ca5Si6O16(OH)2 · 7H2O |
| ⓘ | Foshagite | 9.DG.15 | Ca4(Si3O9)(OH)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Dellaite | Ca6Si3O11(OH)2 |
| H | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| H | ⓘ Foshagite | Ca4(Si3O9)(OH)2 |
| H | ⓘ Plombièrite | Ca5Si6O16(OH)2 · 7H2O |
| H | ⓘ Rustumite | Ca10(Si2O7)2(SiO4)(OH)2Cl2 |
| H | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| C | ⓘ Spurrite | Ca5(SiO4)2(CO3) |
| C | ⓘ Tilleyite | Ca5(Si2O7)(CO3)2 |
| O | Oxygen | |
| O | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| O | ⓘ Dellaite | Ca6Si3O11(OH)2 |
| O | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| O | ⓘ Foshagite | Ca4(Si3O9)(OH)2 |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Kilchoanite | Ca6(SiO4)(Si3O10) |
| O | ⓘ Larnite | Ca2SiO4 |
| O | ⓘ Merwinite | Ca3Mg(SiO4)2 |
| O | ⓘ Monticellite | CaMg(SiO4) |
| O | ⓘ Plombièrite | Ca5Si6O16(OH)2 · 7H2O |
| O | ⓘ Rankinite | Ca3Si2O7 |
| O | ⓘ Rustumite | Ca10(Si2O7)2(SiO4)(OH)2Cl2 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| O | ⓘ Spurrite | Ca5(SiO4)2(CO3) |
| O | ⓘ Tilleyite | Ca5(Si2O7)(CO3)2 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| F | Fluorine | |
| F | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| Mg | Magnesium | |
| Mg | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| Mg | ⓘ Merwinite | Ca3Mg(SiO4)2 |
| Mg | ⓘ Monticellite | CaMg(SiO4) |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | Silicon | |
| Si | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| Si | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| Si | ⓘ Dellaite | Ca6Si3O11(OH)2 |
| Si | ⓘ Foshagite | Ca4(Si3O9)(OH)2 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Kilchoanite | Ca6(SiO4)(Si3O10) |
| Si | ⓘ Larnite | Ca2SiO4 |
| Si | ⓘ Merwinite | Ca3Mg(SiO4)2 |
| Si | ⓘ Monticellite | CaMg(SiO4) |
| Si | ⓘ Plombièrite | Ca5Si6O16(OH)2 · 7H2O |
| Si | ⓘ Rankinite | Ca3Si2O7 |
| Si | ⓘ Rustumite | Ca10(Si2O7)2(SiO4)(OH)2Cl2 |
| Si | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| Si | ⓘ Spurrite | Ca5(SiO4)2(CO3) |
| Si | ⓘ Tilleyite | Ca5(Si2O7)(CO3)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| S | Sulfur | |
| S | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| Cl | Chlorine | |
| Cl | ⓘ Rustumite | Ca10(Si2O7)2(SiO4)(OH)2Cl2 |
| Ca | Calcium | |
| Ca | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| Ca | ⓘ Dellaite | Ca6Si3O11(OH)2 |
| Ca | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| Ca | ⓘ Foshagite | Ca4(Si3O9)(OH)2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Kilchoanite | Ca6(SiO4)(Si3O10) |
| Ca | ⓘ Larnite | Ca2SiO4 |
| Ca | ⓘ Merwinite | Ca3Mg(SiO4)2 |
| Ca | ⓘ Monticellite | CaMg(SiO4) |
| Ca | ⓘ Plombièrite | Ca5Si6O16(OH)2 · 7H2O |
| Ca | ⓘ Rankinite | Ca3Si2O7 |
| Ca | ⓘ Rustumite | Ca10(Si2O7)2(SiO4)(OH)2Cl2 |
| Ca | ⓘ Scawtite | Ca7(Si3O9)2CO3 · 2H2O |
| Ca | ⓘ Spurrite | Ca5(SiO4)2(CO3) |
| Ca | ⓘ Tilleyite | Ca5(Si2O7)(CO3)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Fe | Iron | |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
Localities in this Region
- Scotland
- Highland
- Fort William and Ardnamurchan
- Ardnamurchan
- Kilchoan
- Ardnamurchan
- Fort William and Ardnamurchan
- Highland
Other Regions, Features and Areas containing this locality
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- Laurentia ProvinceCraton
EuropeContinent
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.

Kilchoan, Ardnamurchan, Fort William and Ardnamurchan, Highland, Scotland, UK