Gouverneur Talc Company No. 4 Quarry (Valentine deposit), Diana Township, Lewis County, New York, USAi
| Regional Level Types | |
|---|---|
| Gouverneur Talc Company No. 4 Quarry (Valentine deposit) | Quarry |
| Diana Township | Township |
| Lewis County | County |
| New York | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
44° 7' 22'' North , 75° 22' 41'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Harrisville | 622 (2017) | 5.6km |
| Natural Bridge | 365 (2017) | 11.0km |
| Antwerp | 685 (2017) | 20.1km |
| Hailesboro | 624 (2017) | 21.5km |
| Carthage | 3,591 (2017) | 24.5km |
Wollastonite mine. Located near the village of Harrisville in the township of Diana.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
26 valid minerals. 1 (TL) - type locality of valid minerals. 2 erroneous literature entries.
Detailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Babingtonite Formula: Ca2Fe2+Fe3+Si5O14(OH) |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Brewsterite-Ba (TL) Formula: Ba(Al2Si6)O16 · 5H2O Type Locality: |
| ⓘ Brewsterite-Sr Formula: Sr(Al2Si6)O16 · 5H2O |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Celadonite Formula: K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ Datolite Formula: CaB(SiO4)(OH) |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ 'Diopside-Hedenbergite Series' |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapophyllite-(K) Formula: KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hydroxyapophyllite-(K) Formula: KCa4(Si8O20)(OH,F) · 8H2O |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ 'Manganese Oxides' References: |
| ⓘ 'Manganese Oxides var. Manganese Dendrites' References: |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Orientite Formula: Ca8Mn3+10(SiO4)3(Si3O10)3(OH)10 · 4H2O References: |
| ⓘ Pectolite Formula: NaCa2Si3O8(OH) |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Formula: ◻{Ca2}{Mg5}(Si8O22)(OH)2 Description: No known specimens. Apparently put in this spot because of a confusion with Gouverneur Company and the town of Gouverneur, although chrome-tremolite is not known from Gouverneur, itself, but is found in nearby Balmat. References: |
| ⓘ Formula: ◻{Ca2}{(Mg,Mn)5}(Si8O22)(OH)2 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Graphite | 1.CB.05a | C |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Orientite | 9.BJ.05 | Ca8Mn3+10(SiO4)3(Si3O10)3(OH)10 · 4H2O |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | var. Chrome-Tremolite ? | 9.DE.10 | ◻{Ca2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | var. Hexagonite ? | 9.DE.10 | ◻{Ca2}{(Mg,Mn)5}(Si8O22)(OH)2 |
| ⓘ | Pectolite | 9.DG.05 | NaCa2Si3O8(OH) |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Babingtonite | 9.DK.05 | Ca2Fe2+Fe3+Si5O14(OH) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Fluorapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ | Hydroxyapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(OH,F) · 8H2O |
| ⓘ | Celadonite | 9.EC.15 | K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Brewsterite-Ba (TL) | 9.GE.20 | Ba(Al2Si6)O16 · 5H2O |
| ⓘ | Brewsterite-Sr | 9.GE.20 | Sr(Al2Si6)O16 · 5H2O |
| Unclassified | |||
| ⓘ | 'Diopside-Hedenbergite Series' | - | |
| ⓘ | 'Manganese Oxides var. Manganese Dendrites' | - | |
| ⓘ | '' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| H | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| H | ⓘ Orientite | Ca8Mn103+(SiO4)3(Si3O10)3(OH)10 · 4H2O |
| H | ⓘ Pectolite | NaCa2Si3O8(OH) |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| H | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| H | ⓘ Tremolite var. Chrome-Tremolite | ◻{Ca2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Tremolite var. Hexagonite | ◻{Ca2}{(Mg,Mn)5}(Si8O22)(OH)2 |
| B | Boron | |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Graphite | C |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Orientite | Ca8Mn103+(SiO4)3(Si3O10)3(OH)10 · 4H2O |
| O | ⓘ Pectolite | NaCa2Si3O8(OH) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| O | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| O | ⓘ Diopside-Hedenbergite Series | |
| O | ⓘ Tremolite var. Chrome-Tremolite | ◻{Ca2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Tremolite var. Hexagonite | ◻{Ca2}{(Mg,Mn)5}(Si8O22)(OH)2 |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| F | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Diopside-Hedenbergite Series | |
| Mg | ⓘ Tremolite var. Chrome-Tremolite | ◻{Ca2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Tremolite var. Hexagonite | ◻{Ca2}{(Mg,Mn)5}(Si8O22)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| Al | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Si | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Orientite | Ca8Mn103+(SiO4)3(Si3O10)3(OH)10 · 4H2O |
| Si | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| Si | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| Si | ⓘ Diopside-Hedenbergite Series | |
| Si | ⓘ Tremolite var. Chrome-Tremolite | ◻{Ca2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Tremolite var. Hexagonite | ◻{Ca2}{(Mg,Mn)5}(Si8O22)(OH)2 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| K | Potassium | |
| K | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| K | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| K | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| Ca | ⓘ Orientite | Ca8Mn103+(SiO4)3(Si3O10)3(OH)10 · 4H2O |
| Ca | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Diopside-Hedenbergite Series | |
| Ca | ⓘ Tremolite var. Chrome-Tremolite | ◻{Ca2}{Mg5}(Si8O22)(OH)2 |
| Ca | ⓘ Tremolite var. Hexagonite | ◻{Ca2}{(Mg,Mn)5}(Si8O22)(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Orientite | Ca8Mn103+(SiO4)3(Si3O10)3(OH)10 · 4H2O |
| Mn | ⓘ Tremolite var. Hexagonite | ◻{Ca2}{(Mg,Mn)5}(Si8O22)(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Fe | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Diopside-Hedenbergite Series | |
| Sr | Strontium | |
| Sr | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- Grenville OrogenyOrogenic Belt
- Shawnee DomainDomain
USA
- New York
- Adirondack MountainsMassif
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Coombs, Douglas S., Albert, Alberto, Armbruster, Thomas, Artioli, Gilberto, Colella, Carmine, Galli, Ermanno, Grice, Joel D., Liebau, Friedrich, Mandarino, Joseph A., Minato, Hideo, Nickel, Ernest H., Passaglia, Elio, Peacor, Donald R., Quartier, Simona, Rinaldi, Romano, Ross, Malcolm, Sheppard, Richard A., Tillmanns, Ekkehart, Vezzalini, Giovanna (1998) Recommended nomenclature for zeolite minerals: Report of the Subcommittee on Zeolites of the International Mineralogical Association, Commission on New Minerals and Mineral Names. European Journal of Mineralogy, 10 (5) 1037-1081 doi:10.1127/ejm/10/5/1037




Gouverneur Talc Company No. 4 Quarry, Diana Township, Lewis County, New York, USA