Kadina, Copper Coast Council, South Australia, Australiai
| Regional Level Types | |
|---|---|
| Kadina | Town |
| Copper Coast Council | Local Government Area |
| South Australia | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Kadina | 2,213 (2013) |
Other Languages:
French:
Kadina, District de la Copper Coast, Australie-Méridionale, Australie
Italian:
Kadina, municipalità di Copper Coast, Australia Meridionale, Australia
Russian:
Кадина, Южная Австралия, Австралия
Simplified Chinese:
嘉定拿, 南澳大利亚州, 澳大利亚
Asturian:
Kadina, Australia Meridional
Cebuano:
Kadina, Copper Coast, State of South Australia
Dutch:
Kadina, District Council of the Copper Coast, Zuid-Australië, Australië
Farsi/Persian:
کادینا، استرالیای جنوبی, استرالیای جنوبی, استرالیا
Japanese:
カディナ, 南オーストラリア, オーストラリア
Malagasy:
Kadina
Polish:
Kadina , Australia Południowa, Australia
Portuguese:
Kadina, Austrália Meridional, Austrália
Swedish:
Kadina, Copper Coast, South Australia, Australien
Vietnamese:
Kadina, Nam Úc, Úc
The Wallaroo Smelting works were located at: 137.6264115,-33.9278524.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities19 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Paratacamite | 3.DA.10c | Cu3(Cu,Zn)(OH)6Cl2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | Iron | |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Co | Cobalt | |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Cu | Copper | |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Zn | Zinc | |
| Zn | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| As | Arsenic | |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Kadina,_South_Australia |
|---|---|
| Wikidata ID: | Q3191785 |
| GeoNames ID: | 2068856 |
Localities in this Region
- South Australia
- Copper Coast Council
- South Australia
- Copper Coast Council
Other Regions, Features and Areas that Intersect
Australia
- Adelaide SuperbasinBasin
- South Australia
- Gawler CratonCraton
- Olympic DomainCraton
- Stansbury BasinBasin
- Yorke PeninsulaPeninsula
- Gawler CratonCraton
Australian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences






New Cornwall Mine, Kadina, Copper Coast Council, South Australia, Australia