Misen River, Omine Mountains, Tenkawa village, Yoshino district, Nara Prefecture, Japani
| Regional Level Types | |
|---|---|
| Misen River | River |
| Omine Mountains | Mountain Range |
| Tenkawa village | Village |
| Yoshino district | District |
| Nara Prefecture | Prefecture |
| Japan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
34° 12' 40'' North , 135° 53' 40'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Porphyritic granite of Miocene age exposed along the Misen River.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Ominelite (TL) | 9.AJ.05 | (Fe2+,Mg)(Al,Fe3+)3(SiO4)(BO3)O2 |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Sekaninaite | 9.CJ.10 | Fe2+2Al4Si5O18 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Ominelite | (Fe2+,Mg)(Al,Fe3+)3(SiO4)(BO3)O2 |
| O | Oxygen | |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sekaninaite | Fe22+Al4Si5O18 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Ominelite | (Fe2+,Mg)(Al,Fe3+)3(SiO4)(BO3)O2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Ominelite | (Fe2+,Mg)(Al,Fe3+)3(SiO4)(BO3)O2 |
| Al | Aluminium | |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sekaninaite | Fe22+Al4Si5O18 |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Ominelite | (Fe2+,Mg)(Al,Fe3+)3(SiO4)(BO3)O2 |
| Si | Silicon | |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sekaninaite | Fe22+Al4Si5O18 |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Ominelite | (Fe2+,Mg)(Al,Fe3+)3(SiO4)(BO3)O2 |
| P | Phosphorus | |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | Iron | |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Sekaninaite | Fe22+Al4Si5O18 |
| Fe | ⓘ Ominelite | (Fe2+,Mg)(Al,Fe3+)3(SiO4)(BO3)O2 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
Other Regions, Features and Areas containing this locality
Amur PlateTectonic Plate
AsiaContinent
Eurasian Plate
- Southern Japan ForearcAccretionary Complex
Japan
- Honshu IslandIsland
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Hiroi, Yoshikuni, Grew, Edward S., Motoyoshi, Yoichi, Peacor, Donald R., Rouse, Roland C., Matsubara, Satoshi, Yokoyama, Kazumi, Miyawaki, Ritsuro, Mcgee, James J., Su, Shu-Chun, Hokada, Tomokazu, Furukawa, Noboru, Shibasaki, Hiroshi (2002) Ominelite, (Fe,Mg)Al3BSiO9 (Fe2+analogue of grandidierite), a new mineral from porphyritic granite in Japan. American Mineralogist, 87 (1) 160-170 doi:10.2138/am-2002-0117

Misen River, Omine Mountains, Tenkawa village, Yoshino district, Nara Prefecture, Japan