Clark Mine, Rincon Mountain, Rincon, Rincon Mining District, San Diego County, California, USAi
| Regional Level Types | |
|---|---|
| Clark Mine | Mine |
| Rincon Mountain | Mountain |
| Rincon | - not defined - |
| Rincon Mining District | Mining District |
| San Diego County | County |
| California | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
33° 15' 47'' North , 116° 56' 20'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Valley Center | 9,277 (2011) | 10.2km |
| Hidden Trails | 750 (2008) | 15.8km |
| Hidden Meadows | 3,485 (2011) | 16.7km |
| San Pasqual | 2,041 (2018) | 19.1km |
| Escondido | 151,451 (2017) | 21.1km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Palomar Gem & Mineral Club | Escondido, California | 21km |
| Vista Gem & Mineral Society | Vista, California | 29km |
| Fallbrook Gem and Mineral Society, Inc. | Fallbrook, California | 32km |
A gem-bearing pegmatite mine located in the NE¼SW¼ sec. 36, T10S, R1W, SBM, 3.3 km (2.1 miles) SSE of Rincon.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ 'Almandine-Spessartine Series' References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beryl var. Morganite Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ 'Chlorite Group' |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Description: Occurs as well-formed crystals to 2 inches (5 cm). References: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Feldspar Group' |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F References: |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S Habit: tetrahedral crystals to 2cm on edge Colour: Yellow Description: Occurs as small grains and imperfect crystals in petalite-spodumene rock.
Found in unnamed pegmatite near Clark pegmatite. References: |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O Description: Occurs altering from spodumene. References: |
| ⓘ Lithiophilite Formula: LiMn2+PO4 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ 'Manganese Oxides' References: |
| ⓘ 'Manganese Oxides var. Manganese Dendrites' References: |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Colour: Greenish Description: Occurs as "books" to 1.5 inches (3.75 cm) thick. |
| ⓘ Petalite Formula: LiAl(Si4O10) Habit: Aggreagted into raadiating & divergent acucular grains. Description: Occurs in quartz-spodumene masses. References: |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 Description: Mined commercially. |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Spodumene Formula: LiAlSi2O6 Description: Occurs as crystals in quartz altering to petalite and heulandite. References: |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Morganite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Petalite | 9.EF.05 | LiAl(Si4O10) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Almandine-Spessartine Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Manganese Oxides var. Manganese Dendrites' | - | |
| ⓘ | '' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | Lithium | |
| Li | ⓘ Lithiophilite | LiMn2+PO4 |
| Li | ⓘ Petalite | LiAl(Si4O10) |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Be | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Lithiophilite | LiMn2+PO4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Petalite | LiAl(Si4O10) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Almandine-Spessartine Series | |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Petalite | LiAl(Si4O10) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Almandine-Spessartine Series | |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Petalite | LiAl(Si4O10) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Almandine-Spessartine Series | |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Lithiophilite | LiMn2+PO4 |
| S | Sulfur | |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Lithiophilite | LiMn2+PO4 |
| Mn | ⓘ Almandine-Spessartine Series | |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Almandine-Spessartine Series | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America Plate
- Franciscan DomainDomain
- Peninsular Ranges BatholithVolcanic Arc
- Southern California Borderland BasinsBasin
Pacific PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.





Clark Mine, Rincon Mountain, Rincon, Rincon Mining District, San Diego County, California, USA