Matsuiwa mine (Kohoku mine), Kesennuma City, Miyagi Prefecture, Japani
| Regional Level Types | |
|---|---|
| Matsuiwa mine (Kohoku mine) | Mine |
| Kesennuma City | City |
| Miyagi Prefecture | Prefecture |
| Japan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
38° 58' 0'' North , 141° 31' 10'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Ōfunato | 35,418 (2017) | 20.6km |
| Ichinoseki | 62,970 (2017) | 33.8km |
| Mizusawa | 61,281 (2017) | 38.1km |
| Tōno | 26,781 (2017) | 38.9km |
| Kamaishi | 43,107 (2017) | 45.7km |
Arsenic and copper mine (arsenopyrite was the main ore mineral), started in 1949 and closed in 1974. Mesothermal sulphide veins hosted in early Cretaceous altered andesite and pyroclastics. During the uranium rush in the 1950s, the Matsuiwa mine's ores were also extensively researched because of their small uranium content, maximum 1.4% U3O8, although the average was considerably less.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ 'Limonite' |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ 'Siderogel' Formula: ~FeO(OH) · nH2O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Uraninite Formula: UO2 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Siderogel' | - | ~FeO(OH) · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Siderogel | ~FeO(OH) · nH2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderogel | ~FeO(OH) · nH2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Uraninite | UO2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| Ca | Calcium | |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderogel | ~FeO(OH) · nH2O |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| U | Uranium | |
| U | ⓘ Uraninite | UO2 |
Other Regions, Features and Areas containing this locality
AsiaContinent
Eurasian Plate
- Northern Japan ForearcAccretionary Complex
Japan
- Honshu IslandIsland
Okhotsk PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.