Real quarry, Real, Penalva do Castelo, Viseu, Portugali
| Regional Level Types | |
|---|---|
| Real quarry | Quarry |
| Real | Civil Parish |
| Penalva do Castelo | Municipality |
| Viseu | District |
| Portugal | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
40° 38' 8'' North , 7° 41' 1'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Mangualde | 8,895 (2014) | 7.4km |
| Mesquitela | 954 (2018) | 7.7km |
| Sátão | 4,034 (2018) | 12.5km |
| Rio de Loba | 9,529 (2018) | 16.7km |
| Nelas | 4,190 (2014) | 18.2km |
Name(s) in local language(s):
Pedreira do Real, Real, Penalva do Castelo, Distrito de Viseu, Portugal
Pegmatite; quartz and feldspar.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Feldspar Group' |
| ⓘ Ferberite Formula: FeWO4 References: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Hübnerite Formula: MnWO4 References: |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Formula: Mn4+O2 Description: Black "manganese dendrites" have never been identified as "pyrolusite". See Potter, R. and Rossman, G, 1979, Mineralogy of Manganese Dendrites and Coatings, American Mineralogist, v. 64, p. 1219-1226. |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ Triplite Formula: Mn2+2(PO4)F |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite ? | 4.DB.05 | Mn4+O2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Feldspar Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Triplite | Mn22+(PO4)F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Triplite | Mn22+(PO4)F |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Mn | Manganese | |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Hübnerite | MnWO4 |
| U | Uranium | |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.




Real quarry, Real, Penalva do Castelo, Viseu, Portugal