Härjedalen Province, Swedeni
| Regional Level Types | |
|---|---|
| Härjedalen Province | Province (Historical) |
| Sweden | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Province (Historical) - last checked 2018
Largest Settlements:
| Place | Population |
|---|---|
| Sveg | 2,543 (2017) |
| Funäsdalen | 956 (2017) |
| Hede | 837 (2017) |
| Vemdalen | 549 (2017) |
| Ytterhogdal | 534 (2017) |
| Ulvkälla | 420 (2017) |
Other Languages:
Swedish:
Landskapet Härjedalen, Sverige
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities12 valid minerals.
Detailed Mineral List:
| ⓘ Aegirine Formula: NaFe3+Si2O6 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Nepheline Formula: Na3K(Al4Si4O16) |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Blue Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Habit: elongated prismatic Colour: black Description: Slightly divergent columnar crystal aggregates. References: Ted Johnson collectionIdentification: Visual Identification |
| ⓘ Sodalite Formula: Na4(Si3Al3)O12Cl |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Blue Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Sodalite | 9.FB.10 | Na4(Si3Al3)O12Cl |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| O | Oxygen | |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Quartz var. Blue Quartz | SiO2 |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Mg | Magnesium | |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Si | Silicon | |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Blue Quartz | SiO2 |
| S | Sulfur | |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| Cl | Chlorine | |
| Cl | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| K | Potassium | |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Ca | Calcium | |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | Iron | |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- Jämtland County
- Västernorrland County
- Ånge
- Överturingen
- Ånge
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- CaldeonidesOrogenic Belt
- Transscandinavian Igneous BeltMagmatic Province
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.







Mossbodarna quartz quarry, Överhogdal, Härjedalen, Jämtland County, Sweden