Pegmatite occurrences, Forcel Rosso Gully (Forcel Rosso Pass), Monte Foppa (north slope), Upper Val Saviore, Cevo, Brescia Province, Lombardy, Italyi
This page is currently not sponsored. Click here to sponsor this page.
Type:
Name(s) in local language(s):
Dirupo Forcel Rosso, Monte Foppa (fianco nord), Massiccio dell'Adamello, Parco Naturale Adamello-Brenta, Val Camonica, Provincia di Brescia, Lombardia, Italia
Miarolitic gem-bearing LCT pegmatites in the southernmost gully of Vallone del Forcel Rosso between Punta di Forcel Rosso and the northern slope Monte Foppa (2752 m a.s.l.), disrupted in large blocks in an ancient landslide. The main system of miarolitic cavities has been found at an altitude of about 2220 m.
This find represents the first discovery of a gem-bearing LCT pegmatite in the Alps. Discovered by Mr Giancarlo Celio, a local collector, in November 1999. The pegmatite field is hosted in the thermo-metamorphic contact aureole between the Adamello pluton and the surrounding sediments. The pegmatites dykes are sub-horizontal and hosted in meta-sandstones enriched in accessory tourmaline. The larger veins are up to ca. 1.5 m in thickness, and some tens of meters long. Miarolitic cavities are not common, but they can be locally abundant, with a diameter achieving several decimetres in length, at the coarse-grained cores of the veins.
NOTE: This locality is within one of the protected zones of the park and collecting is only allowed for scientific purposes.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
List of minerals arranged by Strunz 10th Edition classification
| Group 3 - Halides | |||
|---|---|---|---|
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | 'var. Stibiopyrochlore (of Pezzotta et al.)' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Bismutotantalite | 4.DE.30 | BiTaO4 |
| ⓘ | Bismutocolumbite | 4.DE.30 | Bi(Nb,Ta)O4 |
| ⓘ | Stibiotantalite | 4.DE.30 | Sb(Ta,Nb)O4 |
| ⓘ | Stibiocolumbite | 4.DE.30 | Sb(Nb,Ta)O4 |
| ⓘ | 'Roméite Group' | 4.DH. | A2(Sb5+)2O6Z |
| ⓘ | 'Stibiomicrolite (of Groat et al.)' | 4.DH.15 | |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | var. Hafnian Zircon | 9.AD.30 | (Zr,Hf)SiO4 |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Foitite | 9.CK.05 | ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | 'Liddicoatite' | 9.CK.05 | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Rossmanite | 9.CK.05 | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Fluor-elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Fluor-liddicoatite | 9.CK.05 | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Pyrochlore Supergroup var. Betafite (of Hogarth 1977)' | - | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| ⓘ | 'Tourmaline var. Indicolite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Pyrochlore Supergroup var. Stibiobetafite (of Černý et al.)' | - | A2-mD2X6-wZ1-n |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'var. Verdelite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyrochlore Supergroup' | - | A2-mD2X6-wZ1-n |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Pyrochlore Group var. Stibiopyrochlore (of Pezzotta et al.) | A2Nb2(O,OH)6Z |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Li | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| B | Boron | |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline var. Indicolite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| B | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| O | ⓘ Bismutotantalite | BiTaO4 |
| O | ⓘ Bismutocolumbite | Bi(Nb,Ta)O4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Tourmaline var. Indicolite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Stibiotantalite | Sb(Ta,Nb)O4 |
| O | ⓘ Stibiocolumbite | Sb(Nb,Ta)O4 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| O | ⓘ Pyrochlore Group var. Stibiopyrochlore (of Pezzotta et al.) | A2Nb2(O,OH)6Z |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| F | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Al | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| Si | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Ti | Titanium | |
| Ti | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Mn | Manganese | |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| Nb | Niobium | |
| Nb | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Nb | ⓘ Bismutocolumbite | Bi(Nb,Ta)O4 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Stibiotantalite | Sb(Ta,Nb)O4 |
| Nb | ⓘ Stibiocolumbite | Sb(Nb,Ta)O4 |
| Nb | ⓘ Pyrochlore Group var. Stibiopyrochlore (of Pezzotta et al.) | A2Nb2(O,OH)6Z |
| Sb | Antimony | |
| Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| Sb | ⓘ Stibiotantalite | Sb(Ta,Nb)O4 |
| Sb | ⓘ Stibiocolumbite | Sb(Nb,Ta)O4 |
| Hf | Hafnium | |
| Hf | ⓘ Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| Ta | Tantalum | |
| Ta | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ta | ⓘ Bismutotantalite | BiTaO4 |
| Ta | ⓘ Bismutocolumbite | Bi(Nb,Ta)O4 |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ-n |
| Ta | ⓘ Stibiotantalite | Sb(Ta,Nb)O4 |
| Ta | ⓘ Stibiocolumbite | Sb(Nb,Ta)O4 |
| Bi | Bismuth | |
| Bi | ⓘ Bismutotantalite | BiTaO4 |
| Bi | ⓘ Bismutocolumbite | Bi(Nb,Ta)O4 |
| U | Uranium | |
| U | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| U | ⓘ Uraninite | UO2 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Gieré, Reto, Williams, C. Terry (1992) REE-bearing minerals in a Ti-rich vein from the Adamello contact aureole (Italy) Contributions to Mineralogy and Petrology, 112 (1) 83-100 doi:10.1007/bf00310957
Diella, Valeria, Pezzotta, Federico, Bocchio, Rosangela, Marinoni, Nicoletta, Cámara, Fernando, Langone, Antonio, Adamo, Ilaria, Lanzafame, Gabriele (2018) Gem-Quality Tourmaline from LCT Pegmatite in Adamello Massif, Central Southern Alps, Italy: An Investigation of Its Mineralogy, Crystallography and 3D Inclusions. Minerals, 8 (12) 593 doi:10.3390/min8120593





Pegmatite occurrences, Forcel Rosso Gully, Monte Foppa, Upper Val Saviore, Cevo, Brescia Province, Lombardy, Italy