Vila Franca da Serra, Gouveia, Guarda, Portugali
| Regional Level Types | |
|---|---|
| Vila Franca da Serra | Civil Parish |
| Gouveia | Municipality |
| Guarda | District |
| Portugal | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Name(s) in local language(s):
Vila Franca da Serra, Gouveia, Distrito da Guarda, Portugal
Parish of Gouveia municipality.
Mining concession no. 2674 Chão das Poldras (Sn), registered on 23-08-1950 - not licensed.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities12 valid minerals.
Detailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) References: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) References: |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) References: |
| ⓘ Beryl var. Aquamarine Formula: Be3Al2Si6O18 References: |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' References: |
| ⓘ 'Feldspar Group' References: |
| ⓘ Fluorite Formula: CaF2 References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 References: |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| Group 9 - Silicates | |||
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Unclassified | |||
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Mn | Manganese | |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Cu | Copper | |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| GeoNames ID: | 8014107 |
|---|
Localities in this Region
- Guarda
- Gouveia
- Vila Franca da Serra
- Gouveia
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.




Chão das Poldras Mine, Vila Franca da Serra, Gouveia, Guarda, Portugal