Gápeľ copper deposit, Dobšiná mining district, Dobšiná, Rožňava District, Košice Region, Slovakiai
| Regional Level Types | |
|---|---|
| Gápeľ copper deposit | Occurrence |
| Dobšiná mining district | Mining District |
| Dobšiná | Municipality |
| Rožňava District | District |
| Košice Region | Region |
| Slovakia | Country |
Gápeľ copper deposit, Dobšiná mining district, Carpathian Mountains, Europe
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
48° 50' 52'' North , 20° 20' 21'' East
Latitude & Longitude (decimal):
Type:
Age:
298.9 ± 0.15 to 252.17 ± 0.06 Ma
Geologic Time:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Dobšiná | 4,896 (2012) | 3.8km |
| Spišská Nová Ves | 39,195 (2018) | 19.5km |
| Betliar | 938 (2012) | 20.3km |
| Poprad | 57,431 (2014) | 23.9km |
| Revúca | 13,466 (2016) | 24.4km |
Name(s) in local language(s):
Gápeľ, Dobšiná, okres Rožňava, Košický kraj, Slovenská Republika
Hydrothermal quartz-carbonate veins with sulphides hosted in Permian sedimentary rocks. Rich accumulations of chalcopyrite and minerals of the tetrahedrite-tennantite series were mined since the 14th century.
The system of hydrothermal quartz-carbonate veins with ore mineralization at the Gápeľ deposit is hosted in the Permian sandstones of the Knola Formation representing the base of the Krompachy Group. The Gápeľ deposit consists of mostly NW - SE trending, up to 3 m thick ore veins. The three main veins are known: Kýzová (Kiesgang), Chu dobná (Armer Gang) and Bohatá (Reicher Gang) and the average ore was containing up to 2 % of Cu.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
24 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 References: |
| ⓘ Aragonite Formula: CaCO3 References: |
| ⓘ Arsenopyrite Formula: FeAsS References: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 References: |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 References: |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Chalcopyrite Formula: CuFeS2 References: |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Enargite Formula: Cu3AsS4 References: |
| ⓘ Galena Formula: PbS |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O References: |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 References: |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Tangdanite Formula: Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O References: |
| ⓘ Tennantite-(Cu) Formula: Cu6(Cu4Cu2)As4S12S References: |
| ⓘ Tennantite-(Fe) Formula: Cu6(Cu4Fe2+2)As4S12S References: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z References: |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Tennantite-(Cu) | 2.GB. | Cu6(Cu4Cu2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Tennantite-(Fe) | 2.GB.05 | Cu6(Cu4Fe2+2)As4S12S |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Tangdanite | 8.DM.10 | Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| Group 9 - Silicates | |||
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| Unclassified | |||
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Tangdanite | Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| B | Boron | |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Tangdanite | Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tangdanite | Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| S | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| S | ⓘ Tennantite-(Cu) | Cu6(Cu4Cu2)As4S12S |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Tangdanite | Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tangdanite | Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| Cu | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Cu | ⓘ Tennantite-(Cu) | Cu6(Cu4Cu2)As4S12S |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Tangdanite | Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| As | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| As | ⓘ Tennantite-(Cu) | Cu6(Cu4Cu2)As4S12S |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.




Gápeľ copper deposit, Dobšiná mining district, Dobšiná, Rožňava District, Košice Region, Slovakia