Brézouard Massif, Sainte-Marie-aux-Mines, Colmar-Ribeauvillé, Haut-Rhin, Grand Est, Francei
| Regional Level Types | |
|---|---|
| Brézouard Massif | Massif |
| Sainte-Marie-aux-Mines | Commune |
| Colmar-Ribeauvillé | Arrondissement |
| Haut-Rhin | Department |
| Grand Est | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
48° North , 7° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~2km
Type:
Köppen climate type:
Other/historical names associated with this locality:
Massif du Brézouard
The Brézouard massif is made of granite which contain narrow quartz veins with hematite. The hematite crystals can vary in form depending on the vein.
About 10 forms can be observed. Please look at the photo's to see the different forms.
The Brézouard Massif spread over 2 municipalities, Sainte Marie-aux-Mines and Lapoutroie.
The following sub-localities are part of the massif:
- Le Haycot (Le Haïcot).
- La Pierre des Trois Bans.
- Bismuth vein.
The coordinates mark the top of Le Grand Brézouard.
As this locality lies in the Sainte Marie-aux-Mines district, the place is protected by a archaeological mining district status and all collecting is prohibited.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities25 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite Formula: (BiO)2CO3 References: |
| ⓘ Bismutoferrite Formula: Fe3+2Bi(SiO4)2(OH) |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Colour: Golden Description: Specks in quartz associated with bismutinite and emplectite. Nearly always tarnished but on fresh cleavages, the golden colour is well visible. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Eulytine Formula: Bi4(SiO4)3 |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Pierre des Trois Bans, Fréland, Colmar-Ribeauvillé, Haut-Rhin, Grand Est, France Le Haycot (Le Haïcot), Brézouard Massif, Sainte-Marie-aux-Mines, Colmar-Ribeauvillé, Haut-Rhin, Grand Est, France Bismuth vein, Fréland, Colmar-Ribeauvillé, Haut-Rhin, Grand Est, France Brézouard Massif, Sainte-Marie-aux-Mines, Colmar-Ribeauvillé, Haut-Rhin, Grand Est, France |
| ⓘ Hematite Formula: Fe2O3 Localities: Description: Hematite is widespread through the massif.
Many veins, sometimes more than 50 meters long run vertical towards the top.
Hematite specimens can sometimes be found under unrooted trees.
The particularity is that each vein has his own crystal form.
Locally they are known as " la platte, la carrée, la mammelonnée " etc ... So in one vein, you only find one form. There's no mixture of forms in the veins. |
| ⓘ 'Limonite' |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Mixite Formula: BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ Mrázekite Formula: Bi2Cu3(PO4)2O2(OH)2 · H2O |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Carnelian Formula: SiO2 Habit: Massive Colour: Red. Fluorescence: Not fluorescent. Description: While hicking after my visit to the 2025 Ste Marie show, on the 27 of June, I found a specimen of red canelian. The road had been recently enlarged and it was found in the rubble they left on the side of the road. References: Paul De Bondt collection.Identified by Paul De Bondt: Visual Identification |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Ferruginous Quartz Formula: SiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Tavagnascoite Formula: Bi4O4(SO4)(OH)2 |
| ⓘ 'Wolframite Group' |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Carnelian | 4.DA.05 | SiO2 |
| ⓘ | var. Ferruginous Quartz | 4.DA.05 | SiO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Tavagnascoite | 7.BB.35 | Bi4O4(SO4)(OH)2 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Mrázekite | 8.DJ.40 | Bi2Cu3(PO4)2O2(OH)2 · H2O |
| ⓘ | Mixite | 8.DL.15 | BiCu6(AsO4)3(OH)6 · 3H2O |
| Group 9 - Silicates | |||
| ⓘ | Eulytine | 9.AD.40 | Bi4(SiO4)3 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Bismutoferrite | 9.ED.25 | Fe3+2Bi(SiO4)2(OH) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Limonite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Mrázekite | Bi2Cu3(PO4)2O2(OH)2 · H2O |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Tavagnascoite | Bi4O4(SO4)(OH)2 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Eulytine | Bi4(SiO4)3 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Mrázekite | Bi2Cu3(PO4)2O2(OH)2 · H2O |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Carnelian | SiO2 |
| O | ⓘ Quartz var. Ferruginous Quartz | SiO2 |
| O | ⓘ Tavagnascoite | Bi4O4(SO4)(OH)2 |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Eulytine | Bi4(SiO4)3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Carnelian | SiO2 |
| Si | ⓘ Quartz var. Ferruginous Quartz | SiO2 |
| P | Phosphorus | |
| P | ⓘ Mrázekite | Bi2Cu3(PO4)2O2(OH)2 · H2O |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Tavagnascoite | Bi4O4(SO4)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Cu | Copper | |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Mrázekite | Bi2Cu3(PO4)2O2(OH)2 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| As | Arsenic | |
| As | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Bi | Bismuth | |
| Bi | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Eulytine | Bi4(SiO4)3 |
| Bi | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Bi | ⓘ Mrázekite | Bi2Cu3(PO4)2O2(OH)2 · H2O |
| Bi | ⓘ Tavagnascoite | Bi4O4(SO4)(OH)2 |
Localities in this Region
- Grand Est
- Haut-Rhin
- Colmar-Ribeauvillé
- Fréland
- Sainte-Marie-aux-Mines
- Brézouard Massif
- Colmar-Ribeauvillé
- Haut-Rhin
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Moldanubian BeltOrogenic Belt
EuropeContinent
France
- Grand Est
- Vosges
- Vosges Volcanic FieldVolcanic Field
- Vosges
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Brézouard Massif, Sainte-Marie-aux-Mines, Colmar-Ribeauvillé, Haut-Rhin, Grand Est, France