Scuol (Schuls), Engiadina Bassa/Val Müstair Region, Grisons, Switzerlandi
| Regional Level Types | |
|---|---|
| Scuol (Schuls) | Municipality |
| Engiadina Bassa/Val Müstair Region | Region |
| Grisons | Canton |
| Switzerland | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Other Languages:
French:
Scuol, Région d'Engiadina Bassa/Val Müstair, Grisons, Suisse
German:
Scuol, Region Unterengadin/Münstertal, Graubünden, Schweiz
Italian:
Scuol, regione Engiadina Bassa/Val Müstair, Grigioni, Svizzera
Russian:
Скуоль, Граубюнден, Швейцария
Simplified Chinese:
施庫奧爾, 格勞賓登州, 瑞士
Spanish:
Scuol, Grisones, Suiza
Albanian:
Scuol, Kantoni Graubünden, Zvicra
Alemannic:
Scuol, Region Engiadina Bassa/Val Müstair, Kanton Graubünden, Schwiz (Schwiiz)
Arabic:
سكول, كانتون غراوبوندن, سويسرا
Basque:
Scuol, Grisonia, Suitza
Bulgarian:
Скуол, Граубюнден, Швейцария
Catalan:
Scuol, Grisons, Suïssa
Cebuano:
Scuol, Kanton Graubünden, Swisa
Dutch:
Scuol, Graubünden, Zwitserland
Esperanto:
Scuol, Grizono, Svisujo
Finnish:
Scuol, Engiadina Bassa/Val Müstairin alue, Graubünden, Sveitsi
Hebrew:
שקול, גראובינדן, שווייץ
Hungarian:
Scuol, Graubünden kanton, Svájc
Japanese:
シュクオル, グラウビュンデン州, スイス
Kazakh (Cyrillic Script):
Скуоль, Граубюнден, Швейцария
Latin:
Schulles, Grisonia, Helvetia
Lombard:
Scuol, Canton Grisun, Svizera
Malay:
Scuol, Graubünden, Switzerland
Norwegian:
Scuol, Graubünden, Sveits
Norwegian (Nynorsk):
Scuol, Graubünden, Sveits
Occitan:
Scuol, Grisons, Soïssa
Piedmontese:
Scuol, Svìssera
Polish:
Scuol, Region Engiadina Bassa/Val Müstair, Gryzonia, Szwajcaria
Portuguese:
Scuol, Grisões, Suíça
Romanian:
Scuol, Cantonul Grisunilor, Elveția
Romansh:
Scuol, Regiun Engiadina Bassa/Val Müstair, Grischun, Svizra
Swedish:
Scuol, Engiadina Bassa/Val Müstair, Graubünden, Schweiz
Uzbek (Latin Script):
Scuol, Shveysariya
Volapük:
Scuol, Jveizän
Waray:
Scuol, Graubünden, Swiza
Welsh:
Scuol, Canton y Grisons, Y Swistir
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities25 valid minerals.
Detailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Taraspite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tetrahedrite Group' | - | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Dolomite var. Taraspite | CaMg(CO3)2 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Dolomite var. Taraspite | CaMg(CO3)2 |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Dolomite var. Taraspite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tetrahedrite Group | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Dolomite var. Taraspite | CaMg(CO3)2 |
| Ti | Titanium | |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Sb | Antimony | |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Scuol |
|---|---|
| Wikidata ID: | Q69079 |
| GeoNames ID: | 7287130 |
Localities in this Region
- Grisons
- Engiadina Bassa/Val Müstair Region
- Scuol (Schuls)
- Engiadina Bassa/Val Müstair Region
- Grisons
- Engiadina Bassa/Val Müstair Region
- Scuol (Schuls)
- S-charl Valley
- ⭔Tarasp
- Scuol (Schuls)
- Engiadina Bassa/Val Müstair Region
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- AlpsAccretionary Complex
EuropeContinent
- The AlpsMountain Range
Switzerland
- Grisons
- EngadinValley
- Engiadina Bassa/Val Müstair Region
- Müstair ValleyValley
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.



Tarasp, Scuol, Engiadina Bassa/Val Müstair Region, Grisons, Switzerland