Kyotamba, Funai District, Kyoto Prefecture, Japani
| Regional Level Types | |
|---|---|
| Kyotamba | Town |
| Funai District | District |
| Kyoto Prefecture | Prefecture |
| Japan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Town - last checked 2019
Other/historical names associated with this locality:
Wachi
Other Languages:
French:
Wachi, district de Funai, Kyoto, Japon
German:
Kyōtamba, Funai Bezirk, Präfektur Kyōto, Japan
Italian:
Kyōtamba, Distretto di Funai, prefettura di Kyoto, Giappone
Japanese:
和知町, 船井郡, 京都府, 日本
Russian:
Кётамба, Фунаи, Киото, Япония
Simplified Chinese:
和知町, 船井郡, 京都府, 日本
Spanish:
Kyōtamba, Distrito de Funai, Prefectura de Kioto, Japón
Arabic:
كيوتامبا, مقاطعة فوناي, كيوتو, اليابان
Asturian:
Kyōtamba, prefeutura de Kyoto, Xapón
Cebuano:
Kyōtanba-chō, Funai-gun, Kyōto-fu, Hapon
Czech:
Kjótamba, Prefektura Kjóto, Japonsko
Dutch:
Kyōtamba, Funai District, Kioto, Japan
Egyptian Arabic:
كيوتامبا, اليابان
Farsi/Persian:
کیوتامبا، کیوتو, شهرستان فونای، کیوتو, استان کیوتو, ژاپن
Korean:
교탄바정, 후나이군, 교토부, 일본
Malay:
Kyōtamba, Wilayah Kyoto, Jepun
Portuguese:
Kyōtamba, Distrito de Funai, Quioto , Japão
Tagalog:
Kyōtamba, Prepektura ng Kyoto, Hapon
Traditional Chinese:
京丹波町, 船井郡, 京都府, 日本
Ukrainian:
Кьо-Тамба, Повіт Фунай, префектура Кіото, Японія
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities17 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Arsenopyrite Formula: FeAsS References: |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 References: |
| ⓘ 'K Feldspar' |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe1-xS References: |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sphalerite Formula: ZnS References: |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ 'Wolframite Group' |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
Geochronology
Mineralization age: Late/Upper Cretaceous : 91.2 ± 3.7 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||
| Mesozoic | |||||||
| Cretaceous | |||||||
| Late/Upper Cretaceous |
| ||||||
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Ky%C5%8Dtamba,_Kyoto |
|---|---|
| Wikidata ID: | Q1203236 |
| GeoNames ID: | 7412207 |
Localities in this Region
- Kyoto Prefecture
- Funai District
- Kyotamba
- Funai District
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther Regions

Kaneuchi mine, Kyotamba, Funai District, Kyoto Prefecture, Japan