Pegmatite II, Pegmatite occurrences, Zwettler Leiten, Felling, Gföhl, Krems-Land District, Lower Austria, Austriai
| Regional Level Types | |
|---|---|
| Pegmatite II | Pegmatite |
| Pegmatite occurrences | Group of Occurrences |
| Zwettler Leiten | - not defined - |
| Felling | Cadastral Community |
| Gföhl | Municipality |
| Krems-Land District | District |
| Lower Austria | State |
| Austria | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
48° North , 15° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~1km
Type:
Köppen climate type:
Discovered in 1995 during the construction of a forestry road.
Located about 15-20 m away (East of) from the Pegmatite I.
Known for well-formed smoky quartz crystals, reddish garnet crystals and black prismatic tourmaline crystals, occurring in voids in the pegmatite.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
7 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ 'Almandine-Spessartine Series' |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S |
| ⓘ 'K Feldspar' |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) References: Erwin Löffler collectionIdentification: Visual Identification |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sillimanite ? Formula: Al2(SiO4)O |
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Sillimanite ? | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Almandine-Spessartine Series' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Be | Beryllium | |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Almandine-Spessartine Series | |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Almandine-Spessartine Series | |
| Si | Silicon | |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Almandine-Spessartine Series | |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Almandine-Spessartine Series | |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Almandine-Spessartine Series | |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
Other Regions, Features and Areas containing this locality
Austria
- Lower Austria
- ⭔WaldviertelQuarter
Eurasian PlateTectonic Plate
- Moldanubian BeltOrogenic Belt
EuropeContinent
- Bohemian MassifMassif
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Pegmatite II, Pegmatite occurrences, Zwettler Leiten, Felling, Gföhl, Krems-Land District, Lower Austria, Austria