Kokkersvold, Kokkersvold - Blåfjell E18 roadcuts, Langangen, Porsgrunn, Telemark, Norwayi
| Regional Level Types | |
|---|---|
| Kokkersvold | Road Cutting |
| Kokkersvold - Blåfjell E18 roadcuts | Group of Road Cuttings |
| Langangen | Village |
| Porsgrunn | Municipality |
| Telemark | County |
| Norway | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
59° 5' 53'' North , 9° 46' 31'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Fensfeltet Geologiforening | Ulefoss | 33km |
| Vestfold Geologiforening | Holmestrand | 50km |
Other Languages:
Norwegian:
Kokkersvold, Veiskjæringer E 18 Kokkersvold-Blåfjell, Langangen, Porsgrunn, Telemark, Norge
Several syenite pegmatite dikes that were exposed during construction of an new alignment of the highway E18 in the end of 1970s.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
5 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 3 - Halides | |||
|---|---|---|---|
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | 'Luinaite-(OH)' ? | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl var. Schorl-1M | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Luinaite-(OH) | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schorl var. Schorl-1M | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Luinaite-(OH) | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl var. Schorl-1M | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Luinaite-(OH) | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schorl var. Schorl-1M | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Luinaite-(OH) | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl var. Schorl-1M | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Luinaite-(OH) | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Schorl var. Schorl-1M | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Luinaite-(OH) | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Schorl var. Schorl-1M | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| S | Sulfur | |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Fluorite | CaF2 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Fe | Iron | |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Luinaite-(OH) | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Schorl var. Schorl-1M | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Nb | Niobium | |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Baltic Shield
- Sveconorwegian BeltShield
EuropeContinent
Norway
- Oslo Volcanic ProvinceVolcanic Province
- ⭔Vestfold og Telemark (2020-2023)County
ScandinaviaRegion
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Larsen, Alf Olav (1988) Helvite group minerals from syenite pegmatites in the Oslo Region, Norway. Contribution to the mineralogy of Norway, No. 68. Norsk Geologisk Tidsskrift [Norwegian Journal of Geology], 68 (2) 119-124
Kolitsch, Uwe, Andresen, Peter, Husdal, Tomas Andersen, Ertl, Andreas, Haugen, Astrid, Ellingsen, Hans Vidar, Larsen, Alf Olav (2013) Tourmaline-group minerals from Norway, part II: Occurrences of luinaite-(OH) in Tvedalen, Larvik and Porsgrunn, and fluor-liddicoatite, fluor-elbaite and fluor-schorl at Ågskardet, Nordland. Norsk Bergverksmuseum Skrift, 50. 23-41 with analysis of luniaite-(OH) from Kokkersvold
Kokkersvold, Kokkersvold - Blåfjell E18 roadcuts, Langangen, Porsgrunn, Telemark, Norway