Morganton Quarry (Vulcan Materials Co. Quarry), Morganton, Burke County, North Carolina, USAi
| Regional Level Types | |
|---|---|
| Morganton Quarry (Vulcan Materials Co. Quarry) | Quarry |
| Morganton | - not defined - |
| Burke County | County |
| North Carolina | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
35° 45' 44'' North , 81° 39' 11'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Morganton | 16,692 (2017) | 3.4km |
| Drexel | 1,866 (2017) | 4.4km |
| Salem | 2,218 (2017) | 8.1km |
| Valdese | 4,459 (2017) | 8.5km |
| Rutherford College | 1,341 (2017) | 11.9km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| The Catawba Valley Gem & Mineral Club | Hickory, North Carolina | 28km |
Rock types: augen gneiss, chlorite gneiss, amphibolite.
NOTE: Coordinates were discerned from the topo map and street address of the Vulcan Materials Co. at Morganton.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beryl var. Heliodor Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ 'Zeolite Group' References: |
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Heliodor | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 'Zeolite Group' | 9.G0. | |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Si | Silicon | |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- PedmontiaAccretionary Complex
- Piedmontia DomainDomain
USA
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Morganton Quarry, Morganton, Burke County, North Carolina, USA