Delmoe Lake Road occurrences, Pipestone Mining District, Jefferson County, Montana, USAi
| Regional Level Types | |
|---|---|
| Delmoe Lake Road occurrences | Group of Occurrences |
| Pipestone Mining District | Mining District |
| Jefferson County | County |
| Montana | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
45° 55' 18'' North , 112° 16' 10'' West
Latitude & Longitude (decimal):
Type:
Group of Occurrences
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Whitehall | 1,094 (2017) | 14.5km |
| Butte | 34,190 (2011) | 22.4km |
| Walkerville | 700 (2017) | 24.1km |
| Butte-Silver Bow (Balance) | 33,525 (2013) | 30.1km |
| Boulder | 1,207 (2017) | 36.8km |
This is a small area of diverse skarns and altered rocks along the eastern margin of the Butte Pluton of the Boulder Batholith.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities9 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ 'Axinite Group' |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Zoisite var. Thulite Formula: {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 9 - Silicates | |||
|---|---|---|---|
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite var. Thulite | 9.BG.10 | {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
| ⓘ | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) | |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| Unclassified | |||
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Axinite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | Oxygen | |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | Silicon | |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Fe | Iron | |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
Localities in this Region
- Montana
- Jefferson County
- Pipestone Mining District
- Delmoe Lake Road occurrences
- Pipestone Mining District
- Jefferson County
Other Regions, Features and Areas containing this locality
North AmericaContinent
- Rocky MountainsMountain Range
North America PlateTectonic Plate
- Great Falls DomainDomain
- Northern Rocky MountainsWide Rift
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Delmoe Road skarn, Delmoe Lake Road occurrences, Pipestone Mining District, Jefferson County, Montana, USA