Berg, Sollefteå, Västernorrland County, Swedeni
| Regional Level Types | |
|---|---|
| Berg | - not defined - |
| Sollefteå | Municipality |
| Västernorrland County | County |
| Sweden | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
63° 11' 50'' North , 17° 15' 9'' East
Latitude & Longitude (decimal):
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Sollefteå | 7,399 (2017) | 3.5km |
| Långsele | 1,642 (2017) | 9.4km |
| Österforse | 245 (2012) | 12.9km |
| Hammar | 289 (2018) | 17.7km |
| Torsåker | 873 (2018) | 28.9km |
Name(s) in local language(s):
Berg, Sollefteå, Ångermanland, Sverige
Quartz-feldspar quarry in pegmatite. One larger and one smaller.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ 'Almandine-Spessartine Series' |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Graftonite Formula: Fe2+Fe2+2(PO4)2 |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Sarcopside Formula: Fe2+3(PO4)2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Triphylite Formula: LiFe2+PO4 |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ Wolfeite Formula: Fe2+2(PO4)(OH) |
List of minerals arranged by Strunz 10th Edition classification
| Group 8 - Phosphates, Arsenates and Vanadates | |||
|---|---|---|---|
| ⓘ | Triphylite | 8.AB.10 | LiFe2+PO4 |
| ⓘ | Sarcopside | 8.AB.15 | Fe2+3(PO4)2 |
| ⓘ | Graftonite | 8.AB.20 | Fe2+Fe2+2(PO4)2 |
| ⓘ | Wolfeite | 8.BB.15 | Fe2+2(PO4)(OH) |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Almandine-Spessartine Series' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Wolfeite | Fe22+(PO4)(OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Li | Lithium | |
| Li | ⓘ Triphylite | LiFe2+PO4 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Sarcopside | Fe32+(PO4)2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Triphylite | LiFe2+PO4 |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Wolfeite | Fe22+(PO4)(OH) |
| O | ⓘ Almandine-Spessartine Series | |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Almandine-Spessartine Series | |
| Si | Silicon | |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Almandine-Spessartine Series | |
| P | Phosphorus | |
| P | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Sarcopside | Fe32+(PO4)2 |
| P | ⓘ Triphylite | LiFe2+PO4 |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Wolfeite | Fe22+(PO4)(OH) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | ⓘ Almandine-Spessartine Series | |
| Fe | Iron | |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| Fe | ⓘ Sarcopside | Fe32+(PO4)2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Triphylite | LiFe2+PO4 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Wolfeite | Fe22+(PO4)(OH) |
| Fe | ⓘ Almandine-Spessartine Series | |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Baltic Shield
- Bothnia microcontinentShield
EuropeContinent
ScandinaviaRegion
Sweden
- ⭔Ångermanland ProvinceProvince
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.





Berg, Sollefteå, Västernorrland County, Sweden