Tripp No. 1 Mine, Alstead, Cheshire County, New Hampshire, USAi
| Regional Level Types | |
|---|---|
| Tripp No. 1 Mine | Mine |
| Alstead | Town |
| Cheshire County | County |
| New Hampshire | State |
| USA | Country |
This page kindly sponsored by Shann Whynot-Young
Latitude & Longitude (WGS84):
43° North , 72° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~6km
Type:
Köppen climate type:
Granite pegmatite, Alstead field.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beryl var. Aquamarine References: |
| ⓘ Beryl var. Heliodor Formula: Be3Al2(Si6O18) References: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Colour: green, pale blue, white Fluorescence: Fluoresces orange under long-wave UV and yellow under shortwave UV. References: |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | var. Heliodor | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- Ganderia DomainDomain
- GranderiaPassive Margin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Tripp No. 1 Mine, Alstead, Cheshire County, New Hampshire, USA