Southern Pacific Silica Quarry (Southern Pacific deposit; Nuevo Mine; Southern Pacific Quarry; S.P. Silica Quarry; S.P. Mine; Nuevo Quarry), Nuevo, Lakeview Mountains, Riverside County, California, USAi
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
33° 47' 8'' North , 117° 7' 40'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Yucaipa Valley Gem & Mineral Society | Yucaipa, California | 29km |
| Orange Belt Mineralogical Society | San Bernardino, California | 39km |
| Valley Prospectors, Inc. | San Bernardino, California | 39km |
| West End Prospectors Corporation | Norco, California | 42km |
| Fallbrook Gem and Mineral Society, Inc. | Fallbrook, California | 47km |
A feldspar-silica occurrence/quarry located in the NE¼NW¼NE¼ sec. 31, T4S, R2W, SBM, 2.4 km (1.5 miles/8,200 feet) SE of Nuevo, in the Lakeview Mountains. MRDS database stated accuracy for this location is 10 meters.
The Southern Pacific Silica Quarry is not known to have produced spessartine crystals.
"The manganese oxides of the Big Bullet manganese claims are in a gangue of white, fine-grained spessartine (R. B. Saul, et al. 1970, p. 961)."
Mineralization is a granodiorite pegmatite worked for clear massive quartz during WW2. Still occasionally worked for lapidary material, mainly asteriated rose quartz and asteriated smoky quartz. Local rocks include Mesozoic granitic rocks , unit 2 (Peninsular Ranges).Workings include unspecified surface openings (the topo map reflects 1 open cast mine symbol labeled "mine" at this point).
The Southern Pacific Silica Quarry is not known to have produced spessartine crystals.
"The manganese oxides of the Big Bullet manganese claims are in a gangue of white, fine-grained spessartine (R. B. Saul, et al. 1970, p. 961)."
Mineralization is a granodiorite pegmatite worked for clear massive quartz during WW2. Still occasionally worked for lapidary material, mainly asteriated rose quartz and asteriated smoky quartz. Local rocks include Mesozoic granitic rocks , unit 2 (Peninsular Ranges).Workings include unspecified surface openings (the topo map reflects 1 open cast mine symbol labeled "mine" at this point).
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
18 valid minerals.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) References: Russ Rizzo CollectionIdentified by Russ Rizzo: Visual Identification, Dealer/Collection Label |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) References: Russ Rizzo CollectionIdentified by Russ Rizzo: Visual Identification, Dealer/Collection Label |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beryl var. Aquamarine Description: Some occurs here. |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Description: Occurs as large, blade-like plates which make a spectacular showing in the quarry wall. |
| ⓘ Epistilbite Formula: CaAl2Si6O16 · 5H2O Description: Occurs as flaky, feathery material replacing feldspar. References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 References: |
| ⓘ Hematite Formula: Fe2O3 References: |
| ⓘ Hematite var. Specularite Formula: Fe2O3 References: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Description: Occurs as small crystals, separate or in clusters, sometimes badly weathered. |
| ⓘ Microcline Formula: K(AlSi3O8) Description: Occurs as graphic granite. |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) References: |
| ⓘ 'Monazite Group' Formula: REE(PO4) Description: Occurs as small crystals in pegmatite. |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: Russ Rizzo CollectionIdentified by Russ Rizzo: Visual Identification, Dealer/Collection Label |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Phosphuranylite Formula: KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O Description: Bright saturated yellow vitrous films which fluoresce dull-yellow in shortwave similar to phosphuranylite are found with thorogummite. References: |
| ⓘ Quartz Formula: SiO2 Description: Asteriated. |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Quartz var. Star Quartz Formula: SiO2 |
| ⓘ Samarskite-(Y) Formula: YFe3+Nb2O8 Description: Initially believed to be a new mineral named "Nuevite." References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Thorite Formula: Th(SiO4) Colour: Powdery white Description: Occurs as small square crystals. |
| ⓘ Thorite var. Thorogummite Formula: (Th,U)(SiO4)1-x(OH)4x Colour: Powdery white Description: Occurs as small square crystals. |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Xenotime-(Y) Formula: Y(PO4) Description: Occurs as parallel intergrowths with cyrtolite in pegmatite. References: |
| ⓘ Yttrocrasite-(Y) Formula: (Y,Th,Ca,U)(Ti,Fe)2(O,OH)6 Description: A few minute tabular crystals in pegmatite. |
| ⓘ Zircon Formula: Zr(SiO4) Description: Occurs in pegmatite as radial clusters and individual crystals. |
| ⓘ Zircon var. Cyrtolite Formula: Zr[(SiO4),(OH)4] Description: Occurs in pegmatite as radial clusters and individual crystals. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Star Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| ⓘ | Yttrocrasite-(Y) | 4.DG.05 | (Y,Th,Ca,U)(Ti,Fe)2(O,OH)6 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Phosphuranylite | 8.EC.10 | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | var. Thorogummite | 9.AD.30 | (Th,U)(SiO4)1-x(OH)4x |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | var. Cyrtolite | 9.AD.30 | Zr[(SiO4),(OH)4] |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Epistilbite | 9.GD.45 | CaAl2Si6O16 · 5H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| H | ⓘ Yttrocrasite-(Y) | (Y,Th,Ca,U)(Ti,Fe)2(O,OH)6 |
| H | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Star Quartz | SiO2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Yttrocrasite-(Y) | (Y,Th,Ca,U)(Ti,Fe)2(O,OH)6 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Star Quartz | SiO2 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Ca | Calcium | |
| Ca | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Ca | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Ca | ⓘ Yttrocrasite-(Y) | (Y,Th,Ca,U)(Ti,Fe)2(O,OH)6 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Yttrocrasite-(Y) | (Y,Th,Ca,U)(Ti,Fe)2(O,OH)6 |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Yttrocrasite-(Y) | (Y,Th,Ca,U)(Ti,Fe)2(O,OH)6 |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Y | Yttrium | |
| Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Y | ⓘ Yttrocrasite-(Y) | (Y,Th,Ca,U)(Ti,Fe)2(O,OH)6 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| Nb | Niobium | |
| Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Th | Thorium | |
| Th | ⓘ Thorite | Th(SiO4) |
| Th | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| Th | ⓘ Yttrocrasite-(Y) | (Y,Th,Ca,U)(Ti,Fe)2(O,OH)6 |
| U | Uranium | |
| U | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| U | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | ⓘ Yttrocrasite-(Y) | (Y,Th,Ca,U)(Ti,Fe)2(O,OH)6 |
Other Databases
| Link to USGS MRDS: | 10285643 |
|---|
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America Plate
- Franciscan DomainDomain
- Peninsular Ranges BatholithVolcanic Arc
- Southern California Borderland BasinsBasin
Pacific PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Melhase, John (1936a), A new occurrence of rare-earth minerals in California: Mineralogist: 4(1): 11
Fisher, Daniel Jerome (1944), Some southern California pegmatites, USGS, unpublished manuscript: 34.
Murdoch, Joseph (1951) Notes on California Minerals: nuevite=samarskite; trona and hanksite; gaylussite. American Mineralogist, 36 (3-4) 358-361
Southern Pacific Silica Quarry, Nuevo, Lakeview Mountains, Riverside County, California, USA