Nogueiró e Tenões, Braga, Braga, Portugali
| Regional Level Types | |
|---|---|
| Nogueiró e Tenões | Parish |
| Braga | Municipality |
| Braga | District |
| Portugal | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Other Languages:
Portuguese:
Nogueiró e Tenões, Braga, Braga, Portugal
Asturian:
Nogueiró e Tenões, Braga, Distritu de Braga
Minnan / Hokkien-Taiwanese:
Nogueiró e Tenões, Braga, Braga Koān
Parish of Braga municipality. União das Freguesias de Nogueiró e Tenões is a relatively new parish formed in 2013 with the administrative merger of the old parishes of Nogueiró and Tenões.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) References: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) References: |
| ⓘ 'Limonite' References: |
| ⓘ Microcline Formula: K(AlSi3O8) References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) References: |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Limonite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Nogueir%C3%B3_e_Ten%C3%B5es |
|---|---|
| Wikidata ID: | Q18477938 |
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Nogueiró e Tenões, Braga, Braga, Portugal