Quartzite quarry, Mömbris, Aschaffenburg District, Lower Franconia, Bavaria, Germanyi
| Regional Level Types | |
|---|---|
| Quartzite quarry | Quarry (Repurposed) |
| Mömbris | Municipality |
| Aschaffenburg District | District |
| Lower Franconia | Region |
| Bavaria | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 5' 6'' North , 9° 7' 45'' East
Latitude & Longitude (decimal):
Type:
Quarry (Repurposed) - last checked 2024
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Mömbris | 12,287 (2015) | 3.0km |
| Alzenau in Unterfranken | 18,932 (2013) | 4.6km |
| Krombach | 2,172 (2017) | 5.5km |
| Johannesberg | 3,914 (2017) | 6.0km |
| Geiselbach | 2,135 (2017) | 6.4km |
Name(s) in local language(s):
Quarzitsteinbruch, Hemsbach, Mömbris, Aschaffenburg, Spessart, Franken, Bayern, Deutschland
Garnet-bearing quartzite schist and mica schist, iron/manganese oxide veins. Closed since 2008, the quarry is used as a disposal area and has been partially recultivated.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
9 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 References: |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 References: |
| ⓘ Goethite Formula: Fe3+O(OH) References: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 References: |
| ⓘ Lithiophorite Formula: (Al,Li)MnO2(OH)2 References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 References: |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Lithiophorite | 4.FE.25 | (Al,Li)MnO2(OH)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| Group 9 - Silicates | |||
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| Unclassified | |||
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | Lithium | |
| Li | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Na | Sodium | |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| K | Potassium | |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Mn | Manganese | |
| Mn | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Fe | Iron | |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Ba | Barium | |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- KupferschieferMining Field
- Saxo-Thuringian BeltOrogenic Belt
EuropeContinent
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.

Quartzite quarry, Mömbris, Aschaffenburg District, Lower Franconia, Bavaria, Germany