Rondu, Roundu District, Gilgit-Baltistan, Pakistani
| Regional Level Types | |
|---|---|
| Rondu | Village (Former) |
| Roundu District | Administrative District |
| Gilgit-Baltistan | Territory |
| Pakistan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
35° 35' 17'' North , 75° 12' 19'' East
Latitude & Longitude (decimal):
Type:
Village (Former) - last checked 2020
Köppen climate type:
Other/historical names associated with this locality:
Ronda; Mendi
A town on the Indus, 70 km downstream from Skardu, at highway Km 104.
Some pegmatite outcrops in the area.
Some pegmatite outcrops in the area.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities13 valid minerals.
Detailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beryl var. Aquamarine |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F References: |
| ⓘ Fluornatromicrolite Formula: (Na1.5Bi0.5)Ta2O6F References: boyuan zhang CollectionIdentified by boyuan zhang: Dealer/Collection Label |
| ⓘ Microcline Formula: K(AlSi3O8) References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Opal Formula: SiO2 · nH2O References: |
| ⓘ Opal var. Hyalite Formula: SiO2 · nH2O References: |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Rhodochrosite Formula: MnCO3 References: Ed Richard collectionIdentified by Ed Richard: Visual Identification |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 References: boyuan zhang CollectionIdentified by boyuan zhang: Visual Identification, Inferred (explain how) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Hyalite | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Fluornatromicrolite | 4.DH.15 | (Na1.5Bi0.5)Ta2O6F |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Rhodochrosite | MnCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
| O | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ti | Titanium | |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Mn | Manganese | |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Fe | Iron | |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Ta | Tantalum | |
| Ta | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
| Bi | Bismuth | |
| Bi | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
Localities in this Region
Other Regions, Features and Areas containing this locality
AsiaContinent
- HimalayasMountain Range
- Hindukush Himalayan RegionGroup of Mountain Ranges
Eurasian PlateTectonic Plate
- Ladakh ArcVolcanic Arc
Pakistan
- Gilgit-Baltistan
- ⭔Skardu AreaRegion
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.




Rondu, Roundu District, Gilgit-Baltistan, Pakistan