Pejo Valley (Peio Valley), Trento Province, Trentino-Alto Adige/Südtirol, Italyi
| Regional Level Types | |
|---|---|
| Pejo Valley (Peio Valley) | Valley |
| Trento Province | Autonomous Province |
| Trentino-Alto Adige/Südtirol | Autonomous Region |
| Italy | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
46° North , 11° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~70km
Type:
Köppen climate type:
Name(s) in local language(s):
Val di Pejo (Val di Peio), Val di Sole, Provincia di Trento, Trentino-Alto Adige/Südtirol (Trentino-Südtirol), Italia
Side valley of the Sole Valley.
Old iron (magnetite) mines.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities13 valid minerals.
Detailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 References: |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Augite var. Fassaite Formula: (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chrysoberyl Formula: BeAl2O4 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | var. Fassaite | 9.DA.15 | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Al | Aluminium | |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| S | Sulfur | |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
Localities in this Region
- Trentino-Alto Adige/Südtirol
- Trento Province
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- AlpsAccretionary Complex
EuropeContinent
- The AlpsMountain Range
- Ortler Alps (Ortles-Cevedale Group)Range of Mountains and Hills
Italy
- Trentino-Alto Adige/Südtirol
- Trento Province
- Sole ValleyValley
- Trento Province
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.








Pejo Valley, Trento Province, Trentino-Alto Adige/Südtirol, Italy