Dickson's Quarry (Dixon's Quarry), Wilmington, New Castle County, Delaware, USAi
| Regional Level Types | |
|---|---|
| Dickson's Quarry (Dixon's Quarry) | Quarry |
| Wilmington | City |
| New Castle County | County |
| Delaware | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
39° 47' 1'' North , 75° 37' 39'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Greenville | 2,326 (2011) | 2.6km |
| Elsmere | 6,146 (2017) | 5.6km |
| Hockessin | 13,527 (2011) | 5.9km |
| Newport | 1,058 (2017) | 7.9km |
| Pike Creek Valley | 11,217 (2011) | 8.0km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Delaware Mineralogical Society, Inc. | Wilmington, Delaware | 8km |
| Tuscarora Lapidary Society | Brookhaven, Pennsylvania | 23km |
| Delaware Valley Earth Science Society | Woodbury, New Jersey | 41km |
| Delaware Valley Paleontological Society | Philadelphia, Pennsylvania | 44km |
| Philadelphia Mineralogical Society | Philadelphia, Pennsylvania | 44km |
Located 6 to 7 miles NW of Wilmington. A feldspar quarry in pegmatite. Quarry is inaccessible as it lies underneath a reservoir. A pod of serpentine was found nearby.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ 'Asbestos' References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) References: |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 References: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F References: |
| ⓘ Fluorapatite var. Manganese-bearing Fluorapatite Formula: (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) References: |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 References: |
| ⓘ Kyanite Formula: Al2(SiO4)O References: |
| ⓘ Magnesite Formula: MgCO3 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 5 - Nitrates and Carbonates | |||
|---|---|---|---|
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | var. Manganese-bearing Fluorapatite | 8.BN.05 | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified | |||
| ⓘ | 'Asbestos' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Magnesite | MgCO3 |
| O | Oxygen | |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Magnesite | MgCO3 |
| Al | Aluminium | |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Si | Silicon | |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Cl | Chlorine | |
| Cl | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Ca | Calcium | |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Mn | Manganese | |
| Mn | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Fe | Iron | |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- PedmontiaAccretionary Complex
- Piedmontia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Dickson's Quarry, Wilmington, New Castle County, Delaware, USA