Pleasant Valley Pegmatite, Fourmile, Custer Mining District, Custer County, South Dakota, USAi
| Regional Level Types | |
|---|---|
| Pleasant Valley Pegmatite | Pegmatite |
| Fourmile | Unincorporated Community |
| Custer Mining District | Mining District |
| Custer County | County |
| South Dakota | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
43° North , 103° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~4km
Type:
Köppen climate type:
Granite pegmatite. 1 mile (1.61 km) south of Fourmile.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
11 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Alluaudite ? Formula: (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 Description: Probably Ferroalluaudite-Na□ |
| ⓘ 'Alluaudite Group' Description: Added to locality to cover specimens thought to be various members of the alluaudite group, including the unapproved "ferro-alluaudite-Na[]" and undifferentiated members of the alluaudite group, pending further analysis, if any should happen in the future. |
| ⓘ Amblygonite Formula: LiAl(PO4)F |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Columbite-Tantalite' |
| ⓘ 'Ferroalluaudite-Na[]' Formula: ◻4Na4Fe2+4Fe3+8(PO4)12 Description: Mn/Mn + Fe = 0.20-0.29 (magnesian) |
| ⓘ Heterosite Formula: Fe3+(PO4) Description: Mn/Mn + Fe = 0.23 (magnesian) |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Triphylite Formula: LiFe2+PO4 Description: Mn/Mn + Fe = 0.20 (magnesian) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Heterosite | 8.AB.10 | Fe3+(PO4) |
| ⓘ | Triphylite | 8.AB.10 | LiFe2+PO4 |
| ⓘ | Alluaudite ? | 8.AC.10 | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| ⓘ | Amblygonite | 8.BB.05 | LiAl(PO4)F |
| Group 9 - Silicates | |||
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Columbite-Tantalite' | - | |
| ⓘ | 'Alluaudite Group' | - | |
| ⓘ | 'Ferroalluaudite-Na[]' | - | ◻4Na4Fe2+4Fe3+8(PO4)12 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | Lithium | |
| Li | ⓘ Amblygonite | LiAl(PO4)F |
| Li | ⓘ Triphylite | LiFe2+PO4 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| O | ⓘ Amblygonite | LiAl(PO4)F |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Heterosite | Fe3+(PO4) |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Triphylite | LiFe2+PO4 |
| O | ⓘ Ferroalluaudite-Na[] | ◻4Na4Fe42+Fe83+(PO4)12 |
| F | Fluorine | |
| F | ⓘ Amblygonite | LiAl(PO4)F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Ferroalluaudite-Na[] | ◻4Na4Fe42+Fe83+(PO4)12 |
| Mg | Magnesium | |
| Mg | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amblygonite | LiAl(PO4)F |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| P | Phosphorus | |
| P | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| P | ⓘ Amblygonite | LiAl(PO4)F |
| P | ⓘ Heterosite | Fe3+(PO4) |
| P | ⓘ Triphylite | LiFe2+PO4 |
| P | ⓘ Ferroalluaudite-Na[] | ◻4Na4Fe42+Fe83+(PO4)12 |
| S | Sulfur | |
| S | ⓘ Sphalerite | ZnS |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Mn | Manganese | |
| Mn | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Fe | Iron | |
| Fe | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Fe | ⓘ Heterosite | Fe3+(PO4) |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Triphylite | LiFe2+PO4 |
| Fe | ⓘ Ferroalluaudite-Na[] | ◻4Na4Fe42+Fe83+(PO4)12 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- Wyoming CratonCraton
- Wyoming DomainDomain
USA
- Black HillsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.







Pleasant Valley Pegmatite, Fourmile, Custer Mining District, Custer County, South Dakota, USA